6583 remove whole-process swapping

   1 /*
   2  * CDDL HEADER START
   3  *
   4  * The contents of this file are subject to the terms of the
   5  * Common Development and Distribution License (the "License").
   6  * You may not use this file except in compliance with the License.
   7  *
   8  * You can obtain a copy of the license at usr/src/OPENSOLARIS.LICENSE
   9  * or http://www.opensolaris.org/os/licensing.
  10  * See the License for the specific language governing permissions
  11  * and limitations under the License.
  12  *
  13  * When distributing Covered Code, include this CDDL HEADER in each
  14  * file and include the License file at usr/src/OPENSOLARIS.LICENSE.
  15  * If applicable, add the following below this CDDL HEADER, with the
  16  * fields enclosed by brackets "[]" replaced with your own identifying
  17  * information: Portions Copyright [yyyy] [name of copyright owner]
  18  *
  19  * CDDL HEADER END
  20  */
  21 
  22 /*
  23  * Copyright (c) 1994, 2010, Oracle and/or its affiliates. All rights reserved.
  24  * Copyright 2013, Joyent, Inc. All rights reserved.
  25  */
  26 
  27 #include <sys/types.h>
  28 #include <sys/param.h>
  29 #include <sys/sysmacros.h>
  30 #include <sys/cred.h>
  31 #include <sys/proc.h>
  32 #include <sys/strsubr.h>
  33 #include <sys/priocntl.h>
  34 #include <sys/class.h>
  35 #include <sys/disp.h>
  36 #include <sys/procset.h>
  37 #include <sys/debug.h>
  38 #include <sys/kmem.h>
  39 #include <sys/errno.h>
  40 #include <sys/systm.h>
  41 #include <sys/schedctl.h>
  42 #include <sys/vmsystm.h>
  43 #include <sys/atomic.h>
  44 #include <sys/project.h>
  45 #include <sys/modctl.h>
  46 #include <sys/fss.h>
  47 #include <sys/fsspriocntl.h>
  48 #include <sys/cpupart.h>
  49 #include <sys/zone.h>
  50 #include <vm/rm.h>
  51 #include <vm/seg_kmem.h>
  52 #include <sys/tnf_probe.h>
  53 #include <sys/policy.h>
  54 #include <sys/sdt.h>
  55 #include <sys/cpucaps.h>
  56 
  57 /*
  58  * The fair share scheduling class ensures that collections of processes
  59  * (zones and projects) each get their configured share of CPU.  This is in
  60  * contrast to the TS class which considers individual processes.
  61  *
  62  * The FSS cpu-share is set on zones using the zone.cpu-shares rctl and on
  63  * projects using the project.cpu-shares rctl.  By default the value is 1
  64  * and it can range from 0 - 64k.  A value of 0 means that processes in the
  65  * collection will only get CPU resources when there are no other processes
  66  * that need CPU. The cpu-share is used as one of the inputs to calculate a
  67  * thread's "user-mode" priority (umdpri) for the scheduler.  The umdpri falls
  68  * in the range 0-59.  FSS calculates other, internal, priorities which are not
  69  * visible outside of the FSS class.
  70  *
  71  * The FSS class should approximate TS behavior when there are excess CPU
  72  * resources.  When there is a backlog of runnable processes, then the share
  73  * is used as input into the runnable process's priority calculation, where
  74  * the final umdpri is used by the scheduler to determine when the process runs.
  75  *
  76  * Projects in a zone compete with each other for CPU time, receiving CPU
  77  * allocation within a zone proportional to the project's share; at a higher
  78  * level zones compete with each other, receiving allocation in a pset
  79  * proportional to the zone's share.
  80  *
  81  * The FSS priority calculation consists of several parts.
  82  *
  83  * 1) Once per second the fss_update function runs. The first thing it does is
  84  *    call fss_decay_usage. This function does three things.
  85  *
  86  * a) fss_decay_usage first decays the maxfsspri value for the pset.  This
  87  *    value is used in the per-process priority calculation described in step
  88  *    (2b).  The maxfsspri is decayed using the following formula:
  89  *
  90  *                      maxfsspri * fss_nice_decay[NZERO])
  91  *        maxfsspri =  ------------------------------------
  92  *                            FSS_DECAY_BASE
  93  *
  94  *
  95  *     - NZERO is the default process priority (i.e. 20)
  96  *
  97  *    The fss_nice_decay array is a fixed set of values used to adjust the
  98  *    decay rate of processes based on their nice value.  Entries in this
  99  *    array are initialized in fss_init using the following formula:
 100  *
 101  *                        (FSS_DECAY_MAX - FSS_DECAY_MIN) * i
 102  *       FSS_DECAY_MIN + -------------------------------------
 103  *                               FSS_NICE_RANGE - 1
 104  *
 105  *     - FSS_DECAY_MIN is 82 = approximates 65% (82/128)
 106  *     - FSS_DECAY_MAX is 108 = approximates 85% (108/128)
 107  *     - FSS_NICE_RANGE is 40 (range is 0 - 39)
 108  *
 109  * b) The second thing fss_decay_usage does is update each project's "usage"
 110  *    for the last second and then recalculates the project's "share usage".
 111  *
 112  *    The usage value is the recent CPU usage for all of the threads in the
 113  *    project. It is decayed and updated this way:
 114  *
 115  *                  (usage * FSS_DECAY_USG)
 116  *        usage =  ------------------------- + ticks;
 117  *                       FSS_DECAY_BASE
 118  *
 119  *     - FSS_DECAY_BASE is 128 - used instead of 100 so we can shift vs divide
 120  *     - FSS_DECAY_USG is 96 - approximates 75% (96/128)
 121  *     - ticks is updated whenever a process in this project is running
 122  *       when the scheduler's tick processing fires. This is not a simple
 123  *       counter, the values are based on the entries in the fss_nice_tick
 124  *       array (see section 3 below). ticks is then reset to 0 so it can track
 125  *       the next seconds worth of nice-adjusted time for the project.
 126  *
 127  * c) The third thing fss_decay_usage does is update each project's "share
 128  *    usage" (shusage). This is the normalized usage value for the project and
 129  *    is calculated this way:
 130  *
 131  *                pset_shares^2    zone_int_shares^2
 132  *        usage * ------------- * ------------------
 133  *                kpj_shares^2     zone_ext_shares^2
 134  *
 135  *    - usage - see (1b) for more details
 136  *    - pset_shares is the total of all *active* zone shares in the pset (by
 137  *      default there is only one pset)
 138  *    - kpj_shares is the individual project's share (project.cpu-shares rctl)
 139  *    - zone_int_shares is the sum of shares of all active projects within the
 140  *      zone (the zone-internal total)
 141  *    - zone_ext_shares is the share value for the zone (zone.cpu-shares rctl)
 142  *
 143  *    The shusage is used in step (2b) to calculate the thread's new internal
 144  *    priority. A larger shusage value leads to a lower priority.
 145  *
 146  * 2) The fss_update function then calls fss_update_list to update the priority
 147  *    of all threads. This does two things.
 148  *
 149  * a) First the thread's internal priority is decayed using the following
 150  *    formula:
 151  *
 152  *                  fsspri * fss_nice_decay[nice_value])
 153  *        fsspri =  ------------------------------------
 154  *                            FSS_DECAY_BASE
 155  *
 156  *     - FSS_DECAY_BASE is 128 as described above
 157  *
 158  * b) Second, if the thread is runnable (TS_RUN or TS_WAIT) calls fss_newpri
 159  *    to update the user-mode priority (umdpri) of the runnable thread.
 160  *    Threads that are running (TS_ONPROC) or waiting for an event (TS_SLEEP)
 161  *    are not updated at this time. The updated user-mode priority can cause
 162  *    threads to change their position in the run queue.
 163  *
 164  *    The process's new internal fsspri is calculated using the following
 165  *    formula. All runnable threads in the project will use the same shusage
 166  *    and nrunnable values in their calculation.
 167  *
 168  *        fsspri += shusage * nrunnable * ticks
 169  *
 170  *     - shusage is the project's share usage, calculated in (1c)
 171  *     - nrunnable is the number of runnable threads in the project
 172  *     - ticks is the number of ticks this thread ran since the last fss_newpri
 173  *       invocation.
 174  *
 175  *    Finally the process's new user-mode priority is calculated using the
 176  *    following formula:
 177  *
 178  *                              (fsspri * umdprirange)
 179  *        umdpri = maxumdpri - ------------------------
 180  *                                    maxfsspri
 181  *
 182  *     - maxumdpri is MINCLSYSPRI - 1 (i.e. 59)
 183  *     - umdprirange is maxumdpri - 1 (i.e. 58)
 184  *     - maxfsspri is the largest fsspri seen so far, as we're iterating all
 185  *       runnable processes
 186  *
 187  *    Thus, a higher internal priority (fsspri) leads to a lower user-mode
 188  *    priority which means the thread runs less. The fsspri is higher when
 189  *    the project's normalized share usage is higher, when the project has
 190  *    more runnable threads, or when the thread has accumulated more run-time.
 191  *
 192  *    This code has various checks to ensure the resulting umdpri is in the
 193  *    range 1-59.  See fss_newpri for more details.
 194  *
 195  * To reiterate, the above processing is performed once per second to recompute
 196  * the runnable thread user-mode priorities.
 197  *
 198  * 3) The final major component in the priority calculation is the tick
 199  *    processing which occurs on a thread that is running when the clock
 200  *    calls fss_tick.
 201  *
 202  *    A thread can run continuously in user-land (compute-bound) for the
 203  *    fss_quantum (see "dispadmin -c FSS -g" for the configurable properties).
 204  *    The fss_quantum defaults to 11 (i.e. 11 ticks).
 205  *
 206  *    Once the quantum has been consumed, the thread will call fss_newpri to
 207  *    recompute its umdpri priority, as described above in (2b). Threads that
 208  *    were T_ONPROC at the one second interval when runnable thread priorities
 209  *    were recalculated will have their umdpri priority recalculated when their
 210  *    quanta expires.
 211  *
 212  *    To ensure that runnable threads within a project see the expected
 213  *    round-robin behavior, there is a special case in fss_newpri for a thread
 214  *    that has run for its quanta within the one second update interval.  See
 215  *    the handling for the quanta_up parameter within fss_newpri.
 216  *
 217  *    Also of interest, the fss_tick code increments the project's tick value
 218  *    using the fss_nice_tick array entry for the thread's nice value. The idea
 219  *    behind the fss_nice_tick array is that the cost of a tick is lower at
 220  *    positive nice values (so that it doesn't increase the project's usage
 221  *    as much as normal) with a 50% drop at the maximum level and a 50%
 222  *    increase at the minimum level. See (1b). The fss_nice_tick array is
 223  *    initialized in fss_init using the following formula:
 224  *
 225  *         FSS_TICK_COST * (((3 * FSS_NICE_RANGE) / 2) - i)
 226  *        --------------------------------------------------
 227  *                          FSS_NICE_RANGE
 228  *
 229  *     - FSS_TICK_COST is 1000, the tick cost for threads with nice level 0
 230  *
 231  * FSS Data Structures:
 232  *
 233  *                 fsszone
 234  *                  -----           -----
 235  *  -----          |     |         |     |
 236  * |     |-------->|     |<------->|     |<---->...
 237  * |     |          -----           -----
 238  * |     |          ^    ^            ^
 239  * |     |---       |     \            \
 240  *  -----    |      |      \            \
 241  * fsspset   |      |       \            \
 242  *           |      |        \            \
 243  *           |    -----       -----       -----
 244  *            -->|     |<--->|     |<--->|     |
 245  *               |     |     |     |     |     |
 246  *                -----       -----       -----
 247  *               fssproj
 248  *
 249  * That is, fsspsets contain a list of fsszone's that are currently active in
 250  * the pset, and a list of fssproj's, corresponding to projects with runnable
 251  * threads on the pset.  fssproj's in turn point to the fsszone which they
 252  * are a member of.
 253  *
 254  * An fssproj_t is removed when there are no threads in it.
 255  *
 256  * An fsszone_t is removed when there are no projects with threads in it.
 257  */
 258 
 259 static pri_t fss_init(id_t, int, classfuncs_t **);
 260 
 261 static struct sclass fss = {
 262         "FSS",
 263         fss_init,
 264         0
 265 };
 266 
 267 extern struct mod_ops mod_schedops;
 268 
 269 /*
 270  * Module linkage information for the kernel.
 271  */
 272 static struct modlsched modlsched = {
 273         &mod_schedops, "fair share scheduling class", &fss
 274 };
 275 
 276 static struct modlinkage modlinkage = {
 277         MODREV_1, (void *)&modlsched, NULL
 278 };
 279 
 280 #define FSS_MAXUPRI     60
 281 
 282 /*
 283  * The fssproc_t structures are kept in an array of circular doubly linked
 284  * lists.  A hash on the thread pointer is used to determine which list each
 285  * thread should be placed in.  Each list has a dummy "head" which is never
 286  * removed, so the list is never empty.  fss_update traverses these lists to
 287  * update the priorities of threads that have been waiting on the run queue.
 288  */
 289 #define FSS_LISTS               16 /* number of lists, must be power of 2 */
 290 #define FSS_LIST_HASH(t)        (((uintptr_t)(t) >> 9) & (FSS_LISTS - 1))
 291 #define FSS_LIST_NEXT(i)        (((i) + 1) & (FSS_LISTS - 1))
 292 
 293 #define FSS_LIST_INSERT(fssproc)                                \
 294 {                                                               \
 295         int index = FSS_LIST_HASH(fssproc->fss_tp);          \
 296         kmutex_t *lockp = &fss_listlock[index];                     \
 297         fssproc_t *headp = &fss_listhead[index];            \
 298         mutex_enter(lockp);                                     \
 299         fssproc->fss_next = headp->fss_next;                      \
 300         fssproc->fss_prev = headp;                           \
 301         headp->fss_next->fss_prev = fssproc;                      \
 302         headp->fss_next = fssproc;                           \
 303         mutex_exit(lockp);                                      \
 304 }
 305 
 306 #define FSS_LIST_DELETE(fssproc)                                \
 307 {                                                               \
 308         int index = FSS_LIST_HASH(fssproc->fss_tp);          \
 309         kmutex_t *lockp = &fss_listlock[index];                     \
 310         mutex_enter(lockp);                                     \
 311         fssproc->fss_prev->fss_next = fssproc->fss_next;       \
 312         fssproc->fss_next->fss_prev = fssproc->fss_prev;       \
 313         mutex_exit(lockp);                                      \
 314 }
 315 
 316 #define FSS_TICK_COST   1000    /* tick cost for threads with nice level = 0 */
 317 
 318 /*
 319  * Decay rate percentages are based on n/128 rather than n/100 so  that
 320  * calculations can avoid having to do an integer divide by 100 (divide
 321  * by FSS_DECAY_BASE == 128 optimizes to an arithmetic shift).
 322  *
 323  * FSS_DECAY_MIN        =  83/128 ~= 65%
 324  * FSS_DECAY_MAX        = 108/128 ~= 85%
 325  * FSS_DECAY_USG        =  96/128 ~= 75%
 326  */
 327 #define FSS_DECAY_MIN   83      /* fsspri decay pct for threads w/ nice -20 */
 328 #define FSS_DECAY_MAX   108     /* fsspri decay pct for threads w/ nice +19 */
 329 #define FSS_DECAY_USG   96      /* fssusage decay pct for projects */
 330 #define FSS_DECAY_BASE  128     /* base for decay percentages above */
 331 
 332 #define FSS_NICE_MIN    0
 333 #define FSS_NICE_MAX    (2 * NZERO - 1)
 334 #define FSS_NICE_RANGE  (FSS_NICE_MAX - FSS_NICE_MIN + 1)
 335 
 336 static int      fss_nice_tick[FSS_NICE_RANGE];
 337 static int      fss_nice_decay[FSS_NICE_RANGE];
 338 
 339 static pri_t    fss_maxupri = FSS_MAXUPRI; /* maximum FSS user priority */
 340 static pri_t    fss_maxumdpri; /* maximum user mode fss priority */
 341 static pri_t    fss_maxglobpri; /* maximum global priority used by fss class */
 342 static pri_t    fss_minglobpri; /* minimum global priority */
 343 
 344 static fssproc_t fss_listhead[FSS_LISTS];
 345 static kmutex_t fss_listlock[FSS_LISTS];
 346 
 347 static fsspset_t *fsspsets;
 348 static kmutex_t fsspsets_lock;  /* protects fsspsets */
 349 
 350 static id_t     fss_cid;
 351 


 352 static int      fss_quantum = 11;
 353 
 354 static void     fss_newpri(fssproc_t *, boolean_t);
 355 static void     fss_update(void *);
 356 static int      fss_update_list(int);
 357 static void     fss_change_priority(kthread_t *, fssproc_t *);
 358 
 359 static int      fss_admin(caddr_t, cred_t *);
 360 static int      fss_getclinfo(void *);
 361 static int      fss_parmsin(void *);
 362 static int      fss_parmsout(void *, pc_vaparms_t *);
 363 static int      fss_vaparmsin(void *, pc_vaparms_t *);
 364 static int      fss_vaparmsout(void *, pc_vaparms_t *);
 365 static int      fss_getclpri(pcpri_t *);
 366 static int      fss_alloc(void **, int);
 367 static void     fss_free(void *);
 368 
 369 static int      fss_enterclass(kthread_t *, id_t, void *, cred_t *, void *);
 370 static void     fss_exitclass(void *);
 371 static int      fss_canexit(kthread_t *, cred_t *);
 372 static int      fss_fork(kthread_t *, kthread_t *, void *);
 373 static void     fss_forkret(kthread_t *, kthread_t *);
 374 static void     fss_parmsget(kthread_t *, void *);
 375 static int      fss_parmsset(kthread_t *, void *, id_t, cred_t *);
 376 static void     fss_stop(kthread_t *, int, int);
 377 static void     fss_exit(kthread_t *);
 378 static void     fss_active(kthread_t *);
 379 static void     fss_inactive(kthread_t *);


 380 static void     fss_trapret(kthread_t *);
 381 static void     fss_preempt(kthread_t *);
 382 static void     fss_setrun(kthread_t *);
 383 static void     fss_sleep(kthread_t *);
 384 static void     fss_tick(kthread_t *);
 385 static void     fss_wakeup(kthread_t *);
 386 static int      fss_donice(kthread_t *, cred_t *, int, int *);
 387 static int      fss_doprio(kthread_t *, cred_t *, int, int *);
 388 static pri_t    fss_globpri(kthread_t *);
 389 static void     fss_yield(kthread_t *);
 390 static void     fss_nullsys();
 391 
 392 static struct classfuncs fss_classfuncs = {
 393         /* class functions */
 394         fss_admin,
 395         fss_getclinfo,
 396         fss_parmsin,
 397         fss_parmsout,
 398         fss_vaparmsin,
 399         fss_vaparmsout,
 400         fss_getclpri,
 401         fss_alloc,
 402         fss_free,
 403 
 404         /* thread functions */
 405         fss_enterclass,
 406         fss_exitclass,
 407         fss_canexit,
 408         fss_fork,
 409         fss_forkret,
 410         fss_parmsget,
 411         fss_parmsset,
 412         fss_stop,
 413         fss_exit,
 414         fss_active,
 415         fss_inactive,


 416         fss_trapret,
 417         fss_preempt,
 418         fss_setrun,
 419         fss_sleep,
 420         fss_tick,
 421         fss_wakeup,
 422         fss_donice,
 423         fss_globpri,
 424         fss_nullsys,    /* set_process_group */
 425         fss_yield,
 426         fss_doprio,
 427 };
 428 
 429 int
 430 _init()
 431 {
 432         return (mod_install(&modlinkage));
 433 }
 434 
 435 int
 436 _fini()
 437 {
 438         return (EBUSY);
 439 }
 440 
 441 int
 442 _info(struct modinfo *modinfop)
 443 {
 444         return (mod_info(&modlinkage, modinfop));
 445 }
 446 
 447 /*ARGSUSED*/
 448 static int
 449 fss_project_walker(kproject_t *kpj, void *buf)
 450 {
 451         return (0);
 452 }
 453 
 454 void *
 455 fss_allocbuf(int op, int type)
 456 {
 457         fssbuf_t *fssbuf;
 458         void **fsslist;
 459         int cnt;
 460         int i;
 461         size_t size;
 462 
 463         ASSERT(op == FSS_NPSET_BUF || op == FSS_NPROJ_BUF || op == FSS_ONE_BUF);
 464         ASSERT(type == FSS_ALLOC_PROJ || type == FSS_ALLOC_ZONE);
 465         ASSERT(MUTEX_HELD(&cpu_lock));
 466 
 467         fssbuf = kmem_zalloc(sizeof (fssbuf_t), KM_SLEEP);
 468         switch (op) {
 469         case FSS_NPSET_BUF:
 470                 cnt = cpupart_list(NULL, 0, CP_NONEMPTY);
 471                 break;
 472         case FSS_NPROJ_BUF:
 473                 cnt = project_walk_all(ALL_ZONES, fss_project_walker, NULL);
 474                 break;
 475         case FSS_ONE_BUF:
 476                 cnt = 1;
 477                 break;
 478         }
 479 
 480         switch (type) {
 481         case FSS_ALLOC_PROJ:
 482                 size = sizeof (fssproj_t);
 483                 break;
 484         case FSS_ALLOC_ZONE:
 485                 size = sizeof (fsszone_t);
 486                 break;
 487         }
 488         fsslist = kmem_zalloc(cnt * sizeof (void *), KM_SLEEP);
 489         fssbuf->fssb_size = cnt;
 490         fssbuf->fssb_list = fsslist;
 491         for (i = 0; i < cnt; i++)
 492                 fsslist[i] = kmem_zalloc(size, KM_SLEEP);
 493         return (fssbuf);
 494 }
 495 
 496 void
 497 fss_freebuf(fssbuf_t *fssbuf, int type)
 498 {
 499         void **fsslist;
 500         int i;
 501         size_t size;
 502 
 503         ASSERT(fssbuf != NULL);
 504         ASSERT(type == FSS_ALLOC_PROJ || type == FSS_ALLOC_ZONE);
 505         fsslist = fssbuf->fssb_list;
 506 
 507         switch (type) {
 508         case FSS_ALLOC_PROJ:
 509                 size = sizeof (fssproj_t);
 510                 break;
 511         case FSS_ALLOC_ZONE:
 512                 size = sizeof (fsszone_t);
 513                 break;
 514         }
 515 
 516         for (i = 0; i < fssbuf->fssb_size; i++) {
 517                 if (fsslist[i] != NULL)
 518                         kmem_free(fsslist[i], size);
 519         }
 520         kmem_free(fsslist, sizeof (void *) * fssbuf->fssb_size);
 521         kmem_free(fssbuf, sizeof (fssbuf_t));
 522 }
 523 
 524 static fsspset_t *
 525 fss_find_fsspset(cpupart_t *cpupart)
 526 {
 527         int i;
 528         fsspset_t *fsspset = NULL;
 529         int found = 0;
 530 
 531         ASSERT(cpupart != NULL);
 532         ASSERT(MUTEX_HELD(&fsspsets_lock));
 533 
 534         /*
 535          * Search for the cpupart pointer in the array of fsspsets.
 536          */
 537         for (i = 0; i < max_ncpus; i++) {
 538                 fsspset = &fsspsets[i];
 539                 if (fsspset->fssps_cpupart == cpupart) {
 540                         ASSERT(fsspset->fssps_nproj > 0);
 541                         found = 1;
 542                         break;
 543                 }
 544         }
 545         if (found == 0) {
 546                 /*
 547                  * If we didn't find anything, then use the first
 548                  * available slot in the fsspsets array.
 549                  */
 550                 for (i = 0; i < max_ncpus; i++) {
 551                         fsspset = &fsspsets[i];
 552                         if (fsspset->fssps_cpupart == NULL) {
 553                                 ASSERT(fsspset->fssps_nproj == 0);
 554                                 found = 1;
 555                                 break;
 556                         }
 557                 }
 558                 fsspset->fssps_cpupart = cpupart;
 559         }
 560         ASSERT(found == 1);
 561         return (fsspset);
 562 }
 563 
 564 static void
 565 fss_del_fsspset(fsspset_t *fsspset)
 566 {
 567         ASSERT(MUTEX_HELD(&fsspsets_lock));
 568         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 569         ASSERT(fsspset->fssps_nproj == 0);
 570         ASSERT(fsspset->fssps_list == NULL);
 571         ASSERT(fsspset->fssps_zones == NULL);
 572         fsspset->fssps_cpupart = NULL;
 573         fsspset->fssps_maxfsspri = 0;
 574         fsspset->fssps_shares = 0;
 575 }
 576 
 577 /*
 578  * The following routine returns a pointer to the fsszone structure which
 579  * belongs to zone "zone" and cpu partition fsspset, if such structure exists.
 580  */
 581 static fsszone_t *
 582 fss_find_fsszone(fsspset_t *fsspset, zone_t *zone)
 583 {
 584         fsszone_t *fsszone;
 585 
 586         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 587 
 588         if (fsspset->fssps_list != NULL) {
 589                 /*
 590                  * There are projects/zones active on this cpu partition
 591                  * already.  Try to find our zone among them.
 592                  */
 593                 fsszone = fsspset->fssps_zones;
 594                 do {
 595                         if (fsszone->fssz_zone == zone) {
 596                                 return (fsszone);
 597                         }
 598                         fsszone = fsszone->fssz_next;
 599                 } while (fsszone != fsspset->fssps_zones);
 600         }
 601         return (NULL);
 602 }
 603 
 604 /*
 605  * The following routine links new fsszone structure into doubly linked list of
 606  * zones active on the specified cpu partition.
 607  */
 608 static void
 609 fss_insert_fsszone(fsspset_t *fsspset, zone_t *zone, fsszone_t *fsszone)
 610 {
 611         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 612 
 613         fsszone->fssz_zone = zone;
 614         fsszone->fssz_rshares = zone->zone_shares;
 615 
 616         if (fsspset->fssps_zones == NULL) {
 617                 /*
 618                  * This will be the first fsszone for this fsspset
 619                  */
 620                 fsszone->fssz_next = fsszone->fssz_prev = fsszone;
 621                 fsspset->fssps_zones = fsszone;
 622         } else {
 623                 /*
 624                  * Insert this fsszone to the doubly linked list.
 625                  */
 626                 fsszone_t *fssz_head = fsspset->fssps_zones;
 627 
 628                 fsszone->fssz_next = fssz_head;
 629                 fsszone->fssz_prev = fssz_head->fssz_prev;
 630                 fssz_head->fssz_prev->fssz_next = fsszone;
 631                 fssz_head->fssz_prev = fsszone;
 632                 fsspset->fssps_zones = fsszone;
 633         }
 634 }
 635 
 636 /*
 637  * The following routine removes a single fsszone structure from the doubly
 638  * linked list of zones active on the specified cpu partition.  Note that
 639  * global fsspsets_lock must be held in case this fsszone structure is the last
 640  * on the above mentioned list.  Also note that the fsszone structure is not
 641  * freed here, it is the responsibility of the caller to call kmem_free for it.
 642  */
 643 static void
 644 fss_remove_fsszone(fsspset_t *fsspset, fsszone_t *fsszone)
 645 {
 646         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 647         ASSERT(fsszone->fssz_nproj == 0);
 648         ASSERT(fsszone->fssz_shares == 0);
 649         ASSERT(fsszone->fssz_runnable == 0);
 650 
 651         if (fsszone->fssz_next != fsszone) {
 652                 /*
 653                  * This is not the last zone in the list.
 654                  */
 655                 fsszone->fssz_prev->fssz_next = fsszone->fssz_next;
 656                 fsszone->fssz_next->fssz_prev = fsszone->fssz_prev;
 657                 if (fsspset->fssps_zones == fsszone)
 658                         fsspset->fssps_zones = fsszone->fssz_next;
 659         } else {
 660                 /*
 661                  * This was the last zone active in this cpu partition.
 662                  */
 663                 fsspset->fssps_zones = NULL;
 664         }
 665 }
 666 
 667 /*
 668  * The following routine returns a pointer to the fssproj structure
 669  * which belongs to project kpj and cpu partition fsspset, if such structure
 670  * exists.
 671  */
 672 static fssproj_t *
 673 fss_find_fssproj(fsspset_t *fsspset, kproject_t *kpj)
 674 {
 675         fssproj_t *fssproj;
 676 
 677         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 678 
 679         if (fsspset->fssps_list != NULL) {
 680                 /*
 681                  * There are projects running on this cpu partition already.
 682                  * Try to find our project among them.
 683                  */
 684                 fssproj = fsspset->fssps_list;
 685                 do {
 686                         if (fssproj->fssp_proj == kpj) {
 687                                 ASSERT(fssproj->fssp_pset == fsspset);
 688                                 return (fssproj);
 689                         }
 690                         fssproj = fssproj->fssp_next;
 691                 } while (fssproj != fsspset->fssps_list);
 692         }
 693         return (NULL);
 694 }
 695 
 696 /*
 697  * The following routine links new fssproj structure into doubly linked list
 698  * of projects running on the specified cpu partition.
 699  */
 700 static void
 701 fss_insert_fssproj(fsspset_t *fsspset, kproject_t *kpj, fsszone_t *fsszone,
 702     fssproj_t *fssproj)
 703 {
 704         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 705 
 706         fssproj->fssp_pset = fsspset;
 707         fssproj->fssp_proj = kpj;
 708         fssproj->fssp_shares = kpj->kpj_shares;
 709 
 710         fsspset->fssps_nproj++;
 711 
 712         if (fsspset->fssps_list == NULL) {
 713                 /*
 714                  * This will be the first fssproj for this fsspset
 715                  */
 716                 fssproj->fssp_next = fssproj->fssp_prev = fssproj;
 717                 fsspset->fssps_list = fssproj;
 718         } else {
 719                 /*
 720                  * Insert this fssproj to the doubly linked list.
 721                  */
 722                 fssproj_t *fssp_head = fsspset->fssps_list;
 723 
 724                 fssproj->fssp_next = fssp_head;
 725                 fssproj->fssp_prev = fssp_head->fssp_prev;
 726                 fssp_head->fssp_prev->fssp_next = fssproj;
 727                 fssp_head->fssp_prev = fssproj;
 728                 fsspset->fssps_list = fssproj;
 729         }
 730         fssproj->fssp_fsszone = fsszone;
 731         fsszone->fssz_nproj++;
 732         ASSERT(fsszone->fssz_nproj != 0);
 733 }
 734 
 735 /*
 736  * The following routine removes a single fssproj structure from the doubly
 737  * linked list of projects running on the specified cpu partition.  Note that
 738  * global fsspsets_lock must be held in case if this fssproj structure is the
 739  * last on the above mentioned list.  Also note that the fssproj structure is
 740  * not freed here, it is the responsibility of the caller to call kmem_free
 741  * for it.
 742  */
 743 static void
 744 fss_remove_fssproj(fsspset_t *fsspset, fssproj_t *fssproj)
 745 {
 746         fsszone_t *fsszone;
 747 
 748         ASSERT(MUTEX_HELD(&fsspsets_lock));
 749         ASSERT(MUTEX_HELD(&fsspset->fssps_lock));
 750         ASSERT(fssproj->fssp_runnable == 0);
 751 
 752         fsspset->fssps_nproj--;
 753 
 754         fsszone = fssproj->fssp_fsszone;
 755         fsszone->fssz_nproj--;
 756 
 757         if (fssproj->fssp_next != fssproj) {
 758                 /*
 759                  * This is not the last part in the list.
 760                  */
 761                 fssproj->fssp_prev->fssp_next = fssproj->fssp_next;
 762                 fssproj->fssp_next->fssp_prev = fssproj->fssp_prev;
 763                 if (fsspset->fssps_list == fssproj)
 764                         fsspset->fssps_list = fssproj->fssp_next;
 765                 if (fsszone->fssz_nproj == 0)
 766                         fss_remove_fsszone(fsspset, fsszone);
 767         } else {
 768                 /*
 769                  * This was the last project part running
 770                  * at this cpu partition.
 771                  */
 772                 fsspset->fssps_list = NULL;
 773                 ASSERT(fsspset->fssps_nproj == 0);
 774                 ASSERT(fsszone->fssz_nproj == 0);
 775                 fss_remove_fsszone(fsspset, fsszone);
 776                 fss_del_fsspset(fsspset);
 777         }
 778 }
 779 
 780 static void
 781 fss_inactive(kthread_t *t)
 782 {
 783         fssproc_t *fssproc;
 784         fssproj_t *fssproj;
 785         fsspset_t *fsspset;
 786         fsszone_t *fsszone;
 787 
 788         ASSERT(THREAD_LOCK_HELD(t));
 789         fssproc = FSSPROC(t);
 790         fssproj = FSSPROC2FSSPROJ(fssproc);
 791         if (fssproj == NULL)    /* if this thread already exited */
 792                 return;
 793         fsspset = FSSPROJ2FSSPSET(fssproj);
 794         fsszone = fssproj->fssp_fsszone;
 795         disp_lock_enter_high(&fsspset->fssps_displock);
 796         ASSERT(fssproj->fssp_runnable > 0);
 797         if (--fssproj->fssp_runnable == 0) {
 798                 fsszone->fssz_shares -= fssproj->fssp_shares;
 799                 if (--fsszone->fssz_runnable == 0)
 800                         fsspset->fssps_shares -= fsszone->fssz_rshares;
 801         }
 802         ASSERT(fssproc->fss_runnable == 1);
 803         fssproc->fss_runnable = 0;
 804         disp_lock_exit_high(&fsspset->fssps_displock);
 805 }
 806 
 807 static void
 808 fss_active(kthread_t *t)
 809 {
 810         fssproc_t *fssproc;
 811         fssproj_t *fssproj;
 812         fsspset_t *fsspset;
 813         fsszone_t *fsszone;
 814 
 815         ASSERT(THREAD_LOCK_HELD(t));
 816         fssproc = FSSPROC(t);
 817         fssproj = FSSPROC2FSSPROJ(fssproc);
 818         if (fssproj == NULL)    /* if this thread already exited */
 819                 return;
 820         fsspset = FSSPROJ2FSSPSET(fssproj);
 821         fsszone = fssproj->fssp_fsszone;
 822         disp_lock_enter_high(&fsspset->fssps_displock);
 823         if (++fssproj->fssp_runnable == 1) {
 824                 fsszone->fssz_shares += fssproj->fssp_shares;
 825                 if (++fsszone->fssz_runnable == 1)
 826                         fsspset->fssps_shares += fsszone->fssz_rshares;
 827         }
 828         ASSERT(fssproc->fss_runnable == 0);
 829         fssproc->fss_runnable = 1;
 830         disp_lock_exit_high(&fsspset->fssps_displock);
 831 }
 832 
 833 /*
 834  * Fair share scheduler initialization. Called by dispinit() at boot time.
 835  * We can ignore clparmsz argument since we know that the smallest possible
 836  * parameter buffer is big enough for us.
 837  */
 838 /*ARGSUSED*/
 839 static pri_t
 840 fss_init(id_t cid, int clparmsz, classfuncs_t **clfuncspp)
 841 {
 842         int i;
 843 
 844         ASSERT(MUTEX_HELD(&cpu_lock));
 845 
 846         fss_cid = cid;
 847         fss_maxumdpri = minclsyspri - 1;
 848         fss_maxglobpri = minclsyspri;
 849         fss_minglobpri = 0;
 850         fsspsets = kmem_zalloc(sizeof (fsspset_t) * max_ncpus, KM_SLEEP);
 851 
 852         /*
 853          * Initialize the fssproc hash table.
 854          */
 855         for (i = 0; i < FSS_LISTS; i++)
 856                 fss_listhead[i].fss_next = fss_listhead[i].fss_prev =
 857                     &fss_listhead[i];
 858 
 859         *clfuncspp = &fss_classfuncs;
 860 
 861         /*
 862          * Fill in fss_nice_tick and fss_nice_decay arrays:
 863          * The cost of a tick is lower at positive nice values (so that it
 864          * will not increase its project's usage as much as normal) with 50%
 865          * drop at the maximum level and 50% increase at the minimum level.
 866          * The fsspri decay is slower at positive nice values.  fsspri values
 867          * of processes with negative nice levels must decay faster to receive
 868          * time slices more frequently than normal.
 869          */
 870         for (i = 0; i < FSS_NICE_RANGE; i++) {
 871                 fss_nice_tick[i] = (FSS_TICK_COST * (((3 * FSS_NICE_RANGE) / 2)
 872                     - i)) / FSS_NICE_RANGE;
 873                 fss_nice_decay[i] = FSS_DECAY_MIN +
 874                     ((FSS_DECAY_MAX - FSS_DECAY_MIN) * i) /
 875                     (FSS_NICE_RANGE - 1);
 876         }
 877 
 878         return (fss_maxglobpri);
 879 }
 880 
 881 /*
 882  * Calculate the new fss_umdpri based on the usage, the normalized share usage
 883  * and the number of active threads.  Reset the tick counter for this thread.
 884  *
 885  * When calculating the new priority using the standard formula we can hit
 886  * a scenario where we don't have good round-robin behavior.  This would be
 887  * most commonly seen when there is a zone with lots of runnable threads.
 888  * In the bad scenario we will see the following behavior when using the
 889  * standard formula and these conditions:
 890  *
 891  *      - there are multiple runnable threads in the zone (project)
 892  *      - the fssps_maxfsspri is a very large value
 893  *      - (we also know all of these threads will use the project's
 894  *          fssp_shusage)
 895  *
 896  * Under these conditions, a thread with a low fss_fsspri value is chosen
 897  * to run and the thread gets a high fss_umdpri.  This thread can run for
 898  * its full quanta (fss_timeleft) at which time fss_newpri is called to
 899  * calculate the thread's new priority.
 900  *
 901  * In this case, because the newly calculated fsspri value is much smaller
 902  * (orders of magnitude) than the fssps_maxfsspri value, if we used the
 903  * standard formula the thread will still get a high fss_umdpri value and
 904  * will run again for another quanta, even though there are other runnable
 905  * threads in the project.
 906  *
 907  * For a thread that is runnable for a long time, the thread can continue
 908  * to run for many quanta (totaling many seconds) before the thread's fsspri
 909  * exceeds the fssps_maxfsspri and the thread's fss_umdpri is reset back
 910  * down to 1.  This behavior also keeps the fssps_maxfsspr at a high value,
 911  * so that the next runnable thread might repeat this cycle.
 912  *
 913  * This leads to the case where we don't have round-robin behavior at quanta
 914  * granularity, but instead, runnable threads within the project only run
 915  * at several second intervals.
 916  *
 917  * To prevent this scenario from occuring, when a thread has consumed its
 918  * quanta and there are multiple runnable threads in the project, we
 919  * immediately cause the thread to hit fssps_maxfsspri so that it gets
 920  * reset back to 1 and another runnable thread in the project can run.
 921  */
 922 static void
 923 fss_newpri(fssproc_t *fssproc, boolean_t quanta_up)
 924 {
 925         kthread_t *tp;
 926         fssproj_t *fssproj;
 927         fsspset_t *fsspset;
 928         fsszone_t *fsszone;
 929         fsspri_t fsspri, maxfsspri;
 930         uint32_t n_runnable;
 931         pri_t invpri;
 932         uint32_t ticks;
 933 
 934         tp = fssproc->fss_tp;
 935         ASSERT(tp != NULL);
 936 
 937         if (tp->t_cid != fss_cid)
 938                 return;
 939 
 940         ASSERT(THREAD_LOCK_HELD(tp));
 941 
 942         fssproj = FSSPROC2FSSPROJ(fssproc);
 943         fsszone = FSSPROJ2FSSZONE(fssproj);
 944         if (fssproj == NULL)
 945                 /*
 946                  * No need to change priority of exited threads.
 947                  */
 948                 return;
 949 
 950         fsspset = FSSPROJ2FSSPSET(fssproj);
 951         disp_lock_enter_high(&fsspset->fssps_displock);
 952 
 953         ticks = fssproc->fss_ticks;
 954         fssproc->fss_ticks = 0;
 955 
 956         if (fssproj->fssp_shares == 0 || fsszone->fssz_rshares == 0) {
 957                 /*
 958                  * Special case: threads with no shares.
 959                  */
 960                 fssproc->fss_umdpri = fss_minglobpri;
 961                 disp_lock_exit_high(&fsspset->fssps_displock);
 962                 return;
 963         }
 964 
 965         maxfsspri = fsspset->fssps_maxfsspri;
 966         n_runnable = fssproj->fssp_runnable;
 967 
 968         if (quanta_up && n_runnable > 1) {
 969                 fsspri = maxfsspri;
 970         } else {
 971                 /*
 972                  * fsspri += fssp_shusage * nrunnable * ticks
 973                  * If all three values are non-0, this typically calculates to
 974                  * a large number (sometimes > 1M, sometimes > 100B) due to
 975                  * fssp_shusage which can be > 1T.
 976                  */
 977                 fsspri = fssproc->fss_fsspri;
 978                 fsspri += fssproj->fssp_shusage * n_runnable * ticks;
 979         }
 980 
 981         fssproc->fss_fsspri = fsspri;
 982 
 983         /*
 984          * fss_maxumdpri is normally 59, since FSS priorities are 0-59.
 985          * If the previous calculation resulted in 0 (e.g. was 0 and added 0
 986          * because ticks == 0), then instead of 0, we use the largest priority,
 987          * which is still small in comparison to the large numbers we typically
 988          * see.
 989          */
 990         if (fsspri < fss_maxumdpri)
 991                 fsspri = fss_maxumdpri; /* so that maxfsspri is != 0 */
 992 
 993         /*
 994          * The general priority formula:
 995          *
 996          *                      (fsspri * umdprirange)
 997          *   pri = maxumdpri - ------------------------
 998          *                              maxfsspri
 999          *
1000          * If this thread's fsspri is greater than the previous largest
1001          * fsspri, then record it as the new high and priority for this
1002          * thread will be one (the lowest priority assigned to a thread
1003          * that has non-zero shares). Because of this check, maxfsspri can
1004          * change as this function is called via the
1005          * fss_update -> fss_update_list -> fss_newpri code path to update
1006          * all runnable threads. See the code in fss_update for how we
1007          * mitigate this issue.
1008          *
1009          * Note that this formula cannot produce out of bounds priority
1010          * values (0-59); if it is changed, additional checks may need to be
1011          * added.
1012          */
1013         if (fsspri >= maxfsspri) {
1014                 fsspset->fssps_maxfsspri = fsspri;
1015                 disp_lock_exit_high(&fsspset->fssps_displock);
1016                 fssproc->fss_umdpri = 1;
1017         } else {
1018                 disp_lock_exit_high(&fsspset->fssps_displock);
1019                 invpri = (fsspri * (fss_maxumdpri - 1)) / maxfsspri;
1020                 fssproc->fss_umdpri = fss_maxumdpri - invpri;
1021         }
1022 }
1023 
1024 /*
1025  * Decays usages of all running projects, resets their tick counters and
1026  * calcluates the projects normalized share usage. Called once per second from
1027  * fss_update().
1028  */
1029 static void
1030 fss_decay_usage()
1031 {
1032         uint32_t zone_ext_shares, zone_int_shares;
1033         uint32_t kpj_shares, pset_shares;
1034         fsspset_t *fsspset;
1035         fssproj_t *fssproj;
1036         fsszone_t *fsszone;
1037         fsspri_t maxfsspri;
1038         int psetid;
1039         struct zone *zp;
1040 
1041         mutex_enter(&fsspsets_lock);
1042         /*
1043          * Go through all active processor sets and decay usages of projects
1044          * running on them.
1045          */
1046         for (psetid = 0; psetid < max_ncpus; psetid++) {
1047                 fsspset = &fsspsets[psetid];
1048                 mutex_enter(&fsspset->fssps_lock);
1049 
1050                 fsspset->fssps_gen++;
1051 
1052                 if (fsspset->fssps_cpupart == NULL ||
1053                     (fssproj = fsspset->fssps_list) == NULL) {
1054                         mutex_exit(&fsspset->fssps_lock);
1055                         continue;
1056                 }
1057 
1058                 /*
1059                  * Decay maxfsspri for this cpu partition with the
1060                  * fastest possible decay rate.
1061                  */
1062                 disp_lock_enter(&fsspset->fssps_displock);
1063 
1064                 pset_shares = fsspset->fssps_shares;
1065 
1066                 maxfsspri = (fsspset->fssps_maxfsspri *
1067                     fss_nice_decay[NZERO]) / FSS_DECAY_BASE;
1068                 if (maxfsspri < fss_maxumdpri)
1069                         maxfsspri = fss_maxumdpri;
1070                 fsspset->fssps_maxfsspri = maxfsspri;
1071 
1072                 do {
1073                         fsszone = fssproj->fssp_fsszone;
1074                         zp = fsszone->fssz_zone;
1075 
1076                         /*
1077                          * Reset zone's FSS stats if they are from a
1078                          * previous cycle.
1079                          */
1080                         if (fsspset->fssps_gen != zp->zone_fss_gen) {
1081                                 zp->zone_fss_gen = fsspset->fssps_gen;
1082                                 zp->zone_run_ticks = 0;
1083                         }
1084 
1085                         /*
1086                          * Decay project usage, then add in this cycle's
1087                          * nice tick value.
1088                          */
1089                         fssproj->fssp_usage =
1090                             (fssproj->fssp_usage * FSS_DECAY_USG) /
1091                             FSS_DECAY_BASE +
1092                             fssproj->fssp_ticks;
1093 
1094                         fssproj->fssp_ticks = 0;
1095                         zp->zone_run_ticks += fssproj->fssp_tick_cnt;
1096                         fssproj->fssp_tick_cnt = 0;
1097 
1098                         /*
1099                          * Readjust the project's number of shares if it has
1100                          * changed since we checked it last time.
1101                          */
1102                         kpj_shares = fssproj->fssp_proj->kpj_shares;
1103                         if (fssproj->fssp_shares != kpj_shares) {
1104                                 if (fssproj->fssp_runnable != 0) {
1105                                         fsszone->fssz_shares -=
1106                                             fssproj->fssp_shares;
1107                                         fsszone->fssz_shares += kpj_shares;
1108                                 }
1109                                 fssproj->fssp_shares = kpj_shares;
1110                         }
1111 
1112                         /*
1113                          * Readjust the zone's number of shares if it
1114                          * has changed since we checked it last time.
1115                          */
1116                         zone_ext_shares = zp->zone_shares;
1117                         if (fsszone->fssz_rshares != zone_ext_shares) {
1118                                 if (fsszone->fssz_runnable != 0) {
1119                                         fsspset->fssps_shares -=
1120                                             fsszone->fssz_rshares;
1121                                         fsspset->fssps_shares +=
1122                                             zone_ext_shares;
1123                                         pset_shares = fsspset->fssps_shares;
1124                                 }
1125                                 fsszone->fssz_rshares = zone_ext_shares;
1126                         }
1127                         zone_int_shares = fsszone->fssz_shares;
1128 
1129                         /*
1130                          * If anything is runnable in the project, track the
1131                          * overall project share percent for monitoring useage.
1132                          */
1133                         if (fssproj->fssp_runnable > 0) {
1134                                 uint32_t zone_shr_pct;
1135                                 uint32_t int_shr_pct;
1136 
1137                                 /*
1138                                  * Times 1000 to get tenths of a percent
1139                                  *
1140                                  *                zone_ext_shares
1141                                  * zone_shr_pct = ---------------
1142                                  *                pset_shares
1143                                  *
1144                                  *                kpj_shares
1145                                  * int_shr_pct =  ---------------
1146                                  *                zone_int_shares
1147                                  */
1148                                 if (pset_shares == 0 || zone_int_shares == 0) {
1149                                         fssproj->fssp_shr_pct = 0;
1150                                 } else {
1151                                         zone_shr_pct =
1152                                             (zone_ext_shares * 1000) /
1153                                             pset_shares;
1154                                         int_shr_pct = (kpj_shares * 1000) /
1155                                             zone_int_shares;
1156                                         fssproj->fssp_shr_pct =
1157                                             (zone_shr_pct * int_shr_pct) /
1158                                             1000;
1159                                 }
1160                         } else {
1161                                 DTRACE_PROBE1(fss__prj__norun, fssproj_t *,
1162                                     fssproj);
1163                         }
1164 
1165                         /*
1166                          * Calculate fssp_shusage value to be used
1167                          * for fsspri increments for the next second.
1168                          */
1169                         if (kpj_shares == 0 || zone_ext_shares == 0) {
1170                                 fssproj->fssp_shusage = 0;
1171                         } else if (FSSPROJ2KPROJ(fssproj) == proj0p) {
1172                                 uint32_t zone_shr_pct;
1173 
1174                                 /*
1175                                  * Project 0 in the global zone has 50%
1176                                  * of its zone. See calculation above for
1177                                  * the zone's share percent.
1178                                  */
1179                                 if (pset_shares == 0)
1180                                         zone_shr_pct = 1000;
1181                                 else
1182                                         zone_shr_pct =
1183                                             (zone_ext_shares * 1000) /
1184                                             pset_shares;
1185 
1186                                 fssproj->fssp_shr_pct = zone_shr_pct / 2;
1187 
1188                                 fssproj->fssp_shusage = (fssproj->fssp_usage *
1189                                     zone_int_shares * zone_int_shares) /
1190                                     (zone_ext_shares * zone_ext_shares);
1191                         } else {
1192                                 /*
1193                                  * Thread's priority is based on its project's
1194                                  * normalized usage (shusage) value which gets
1195                                  * calculated this way:
1196                                  *
1197                                  *         pset_shares^2    zone_int_shares^2
1198                                  * usage * ------------- * ------------------
1199                                  *         kpj_shares^2     zone_ext_shares^2
1200                                  *
1201                                  * Where zone_int_shares is the sum of shares
1202                                  * of all active projects within the zone (and
1203                                  * the pset), and zone_ext_shares is the number
1204                                  * of zone shares (ie, zone.cpu-shares).
1205                                  *
1206                                  * If there is only one zone active on the pset
1207                                  * the above reduces to:
1208                                  *
1209                                  *                      zone_int_shares^2
1210                                  * shusage = usage * ---------------------
1211                                  *                      kpj_shares^2
1212                                  *
1213                                  * If there's only one project active in the
1214                                  * zone this formula reduces to:
1215                                  *
1216                                  *                      pset_shares^2
1217                                  * shusage = usage * ----------------------
1218                                  *                      zone_ext_shares^2
1219                                  *
1220                                  * shusage is one input to calculating fss_pri
1221                                  * in fss_newpri(). Larger values tend toward
1222                                  * lower priorities for processes in the proj.
1223                                  */
1224                                 fssproj->fssp_shusage = fssproj->fssp_usage *
1225                                     pset_shares * zone_int_shares;
1226                                 fssproj->fssp_shusage /=
1227                                     kpj_shares * zone_ext_shares;
1228                                 fssproj->fssp_shusage *=
1229                                     pset_shares * zone_int_shares;
1230                                 fssproj->fssp_shusage /=
1231                                     kpj_shares * zone_ext_shares;
1232                         }
1233                         fssproj = fssproj->fssp_next;
1234                 } while (fssproj != fsspset->fssps_list);
1235 
1236                 disp_lock_exit(&fsspset->fssps_displock);
1237                 mutex_exit(&fsspset->fssps_lock);
1238         }
1239         mutex_exit(&fsspsets_lock);
1240 }
1241 
1242 static void
1243 fss_change_priority(kthread_t *t, fssproc_t *fssproc)
1244 {
1245         pri_t new_pri;
1246 
1247         ASSERT(THREAD_LOCK_HELD(t));
1248         new_pri = fssproc->fss_umdpri;
1249         ASSERT(new_pri >= 0 && new_pri <= fss_maxglobpri);
1250 
1251         t->t_cpri = fssproc->fss_upri;
1252         fssproc->fss_flags &= ~FSSRESTORE;
1253         if (t == curthread || t->t_state == TS_ONPROC) {
1254                 /*
1255                  * curthread is always onproc
1256                  */
1257                 cpu_t *cp = t->t_disp_queue->disp_cpu;
1258                 THREAD_CHANGE_PRI(t, new_pri);
1259                 if (t == cp->cpu_dispthread)
1260                         cp->cpu_dispatch_pri = DISP_PRIO(t);
1261                 if (DISP_MUST_SURRENDER(t)) {
1262                         fssproc->fss_flags |= FSSBACKQ;
1263                         cpu_surrender(t);
1264                 } else {
1265                         fssproc->fss_timeleft = fss_quantum;
1266                 }
1267         } else {
1268                 /*
1269                  * When the priority of a thread is changed, it may be
1270                  * necessary to adjust its position on a sleep queue or
1271                  * dispatch queue.  The function thread_change_pri accomplishes
1272                  * this.
1273                  */
1274                 if (thread_change_pri(t, new_pri, 0)) {
1275                         /*
1276                          * The thread was on a run queue.
1277                          */
1278                         fssproc->fss_timeleft = fss_quantum;
1279                 } else {
1280                         fssproc->fss_flags |= FSSBACKQ;
1281                 }
1282         }
1283 }
1284 
1285 /*
1286  * Update priorities of all fair-sharing threads that are currently runnable
1287  * at a user mode priority based on the number of shares and current usage.
1288  * Called once per second via timeout which we reset here.
1289  *
1290  * There are several lists of fair-sharing threads broken up by a hash on the
1291  * thread pointer.  Each list has its own lock.  This avoids blocking all
1292  * fss_enterclass, fss_fork, and fss_exitclass operations while fss_update runs.
1293  * fss_update traverses each list in turn.
1294  *
1295  * Each time we're run (once/second) we may start at the next list and iterate
1296  * through all of the lists. By starting with a different list, we mitigate any
1297  * effects we would see updating the fssps_maxfsspri value in fss_newpri.
1298  */
1299 static void
1300 fss_update(void *arg)
1301 {
1302         int i;
1303         int new_marker = -1;
1304         static int fss_update_marker;
1305 
1306         /*
1307          * Decay and update usages for all projects.
1308          */
1309         fss_decay_usage();
1310 
1311         /*
1312          * Start with the fss_update_marker list, then do the rest.
1313          */
1314         i = fss_update_marker;
1315 
1316         /*
1317          * Go around all threads, set new priorities and decay
1318          * per-thread CPU usages.
1319          */
1320         do {
1321                 /*
1322                  * If this is the first list after the current marker to have
1323                  * threads with priority updates, advance the marker to this
1324                  * list for the next time fss_update runs.
1325                  */
1326                 if (fss_update_list(i) &&
1327                     new_marker == -1 && i != fss_update_marker)
1328                         new_marker = i;
1329         } while ((i = FSS_LIST_NEXT(i)) != fss_update_marker);
1330 
1331         /*
1332          * Advance marker for the next fss_update call
1333          */
1334         if (new_marker != -1)
1335                 fss_update_marker = new_marker;
1336 
1337         (void) timeout(fss_update, arg, hz);
1338 }
1339 
1340 /*
1341  * Updates priority for a list of threads.  Returns 1 if the priority of one
1342  * of the threads was actually updated, 0 if none were for various reasons
1343  * (thread is no longer in the FSS class, is not runnable, has the preemption
1344  * control no-preempt bit set, etc.)
1345  */
1346 static int
1347 fss_update_list(int i)
1348 {
1349         fssproc_t *fssproc;
1350         fssproj_t *fssproj;
1351         fsspri_t fsspri;
1352         pri_t fss_umdpri;
1353         kthread_t *t;
1354         int updated = 0;
1355 
1356         mutex_enter(&fss_listlock[i]);
1357         for (fssproc = fss_listhead[i].fss_next; fssproc != &fss_listhead[i];
1358             fssproc = fssproc->fss_next) {
1359                 t = fssproc->fss_tp;
1360                 /*
1361                  * Lock the thread and verify the state.
1362                  */
1363                 thread_lock(t);
1364                 /*
1365                  * Skip the thread if it is no longer in the FSS class or
1366                  * is running with kernel mode priority.
1367                  */
1368                 if (t->t_cid != fss_cid)
1369                         goto next;
1370                 if ((fssproc->fss_flags & FSSKPRI) != 0)
1371                         goto next;
1372 
1373                 fssproj = FSSPROC2FSSPROJ(fssproc);
1374                 if (fssproj == NULL)
1375                         goto next;
1376 
1377                 if (fssproj->fssp_shares != 0) {
1378                         /*
1379                          * Decay fsspri value.
1380                          */
1381                         fsspri = fssproc->fss_fsspri;
1382                         fsspri = (fsspri * fss_nice_decay[fssproc->fss_nice]) /
1383                             FSS_DECAY_BASE;
1384                         fssproc->fss_fsspri = fsspri;
1385                 }
1386 
1387                 if (t->t_schedctl && schedctl_get_nopreempt(t))
1388                         goto next;
1389                 if (t->t_state != TS_RUN && t->t_state != TS_WAIT) {
1390                         /*
1391                          * Make next syscall/trap call fss_trapret
1392                          */
1393                         t->t_trapret = 1;
1394                         aston(t);
1395                         if (t->t_state == TS_ONPROC)
1396                                 DTRACE_PROBE1(fss__onproc, fssproc_t *,
1397                                     fssproc);
1398                         goto next;
1399                 }
1400                 fss_newpri(fssproc, B_FALSE);
1401                 updated = 1;
1402 
1403                 fss_umdpri = fssproc->fss_umdpri;
1404 
1405                 /*
1406                  * Only dequeue the thread if it needs to be moved; otherwise
1407                  * it should just round-robin here.
1408                  */
1409                 if (t->t_pri != fss_umdpri)
1410                         fss_change_priority(t, fssproc);
1411 next:
1412                 thread_unlock(t);
1413         }
1414         mutex_exit(&fss_listlock[i]);
1415         return (updated);
1416 }
1417 
1418 /*ARGSUSED*/
1419 static int
1420 fss_admin(caddr_t uaddr, cred_t *reqpcredp)
1421 {
1422         fssadmin_t fssadmin;
1423 
1424         if (copyin(uaddr, &fssadmin, sizeof (fssadmin_t)))
1425                 return (EFAULT);
1426 
1427         switch (fssadmin.fss_cmd) {
1428         case FSS_SETADMIN:
1429                 if (secpolicy_dispadm(reqpcredp) != 0)
1430                         return (EPERM);
1431                 if (fssadmin.fss_quantum <= 0 || fssadmin.fss_quantum >= hz)
1432                         return (EINVAL);
1433                 fss_quantum = fssadmin.fss_quantum;
1434                 break;
1435         case FSS_GETADMIN:
1436                 fssadmin.fss_quantum = fss_quantum;
1437                 if (copyout(&fssadmin, uaddr, sizeof (fssadmin_t)))
1438                         return (EFAULT);
1439                 break;
1440         default:
1441                 return (EINVAL);
1442         }
1443         return (0);
1444 }
1445 
1446 static int
1447 fss_getclinfo(void *infop)
1448 {
1449         fssinfo_t *fssinfo = (fssinfo_t *)infop;
1450         fssinfo->fss_maxupri = fss_maxupri;
1451         return (0);
1452 }
1453 
1454 static int
1455 fss_parmsin(void *parmsp)
1456 {
1457         fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1458 
1459         /*
1460          * Check validity of parameters.
1461          */
1462         if ((fssparmsp->fss_uprilim > fss_maxupri ||
1463             fssparmsp->fss_uprilim < -fss_maxupri) &&
1464             fssparmsp->fss_uprilim != FSS_NOCHANGE)
1465                 return (EINVAL);
1466 
1467         if ((fssparmsp->fss_upri > fss_maxupri ||
1468             fssparmsp->fss_upri < -fss_maxupri) &&
1469             fssparmsp->fss_upri != FSS_NOCHANGE)
1470                 return (EINVAL);
1471 
1472         return (0);
1473 }
1474 
1475 /*ARGSUSED*/
1476 static int
1477 fss_parmsout(void *parmsp, pc_vaparms_t *vaparmsp)
1478 {
1479         return (0);
1480 }
1481 
1482 static int
1483 fss_vaparmsin(void *parmsp, pc_vaparms_t *vaparmsp)
1484 {
1485         fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1486         int priflag = 0;
1487         int limflag = 0;
1488         uint_t cnt;
1489         pc_vaparm_t *vpp = &vaparmsp->pc_parms[0];
1490 
1491         /*
1492          * FSS_NOCHANGE (-32768) is outside of the range of values for
1493          * fss_uprilim and fss_upri.  If the structure fssparms_t is changed,
1494          * FSS_NOCHANGE should be replaced by a flag word.
1495          */
1496         fssparmsp->fss_uprilim = FSS_NOCHANGE;
1497         fssparmsp->fss_upri = FSS_NOCHANGE;
1498 
1499         /*
1500          * Get the varargs parameter and check validity of parameters.
1501          */
1502         if (vaparmsp->pc_vaparmscnt > PC_VAPARMCNT)
1503                 return (EINVAL);
1504 
1505         for (cnt = 0; cnt < vaparmsp->pc_vaparmscnt; cnt++, vpp++) {
1506                 switch (vpp->pc_key) {
1507                 case FSS_KY_UPRILIM:
1508                         if (limflag++)
1509                                 return (EINVAL);
1510                         fssparmsp->fss_uprilim = (pri_t)vpp->pc_parm;
1511                         if (fssparmsp->fss_uprilim > fss_maxupri ||
1512                             fssparmsp->fss_uprilim < -fss_maxupri)
1513                                 return (EINVAL);
1514                         break;
1515                 case FSS_KY_UPRI:
1516                         if (priflag++)
1517                                 return (EINVAL);
1518                         fssparmsp->fss_upri = (pri_t)vpp->pc_parm;
1519                         if (fssparmsp->fss_upri > fss_maxupri ||
1520                             fssparmsp->fss_upri < -fss_maxupri)
1521                                 return (EINVAL);
1522                         break;
1523                 default:
1524                         return (EINVAL);
1525                 }
1526         }
1527 
1528         if (vaparmsp->pc_vaparmscnt == 0) {
1529                 /*
1530                  * Use default parameters.
1531                  */
1532                 fssparmsp->fss_upri = fssparmsp->fss_uprilim = 0;
1533         }
1534 
1535         return (0);
1536 }
1537 
1538 /*
1539  * Copy all selected fair-sharing class parameters to the user.  The parameters
1540  * are specified by a key.
1541  */
1542 static int
1543 fss_vaparmsout(void *parmsp, pc_vaparms_t *vaparmsp)
1544 {
1545         fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1546         int priflag = 0;
1547         int limflag = 0;
1548         uint_t cnt;
1549         pc_vaparm_t *vpp = &vaparmsp->pc_parms[0];
1550 
1551         ASSERT(MUTEX_NOT_HELD(&curproc->p_lock));
1552 
1553         if (vaparmsp->pc_vaparmscnt > PC_VAPARMCNT)
1554                 return (EINVAL);
1555 
1556         for (cnt = 0; cnt < vaparmsp->pc_vaparmscnt; cnt++, vpp++) {
1557                 switch (vpp->pc_key) {
1558                 case FSS_KY_UPRILIM:
1559                         if (limflag++)
1560                                 return (EINVAL);
1561                         if (copyout(&fssparmsp->fss_uprilim,
1562                             (caddr_t)(uintptr_t)vpp->pc_parm, sizeof (pri_t)))
1563                                 return (EFAULT);
1564                         break;
1565                 case FSS_KY_UPRI:
1566                         if (priflag++)
1567                                 return (EINVAL);
1568                         if (copyout(&fssparmsp->fss_upri,
1569                             (caddr_t)(uintptr_t)vpp->pc_parm, sizeof (pri_t)))
1570                                 return (EFAULT);
1571                         break;
1572                 default:
1573                         return (EINVAL);
1574                 }
1575         }
1576 
1577         return (0);
1578 }
1579 
1580 /*
1581  * Return the user mode scheduling priority range.
1582  */
1583 static int
1584 fss_getclpri(pcpri_t *pcprip)
1585 {
1586         pcprip->pc_clpmax = fss_maxupri;
1587         pcprip->pc_clpmin = -fss_maxupri;
1588         return (0);
1589 }
1590 
1591 static int
1592 fss_alloc(void **p, int flag)
1593 {
1594         void *bufp;
1595 
1596         if ((bufp = kmem_zalloc(sizeof (fssproc_t), flag)) == NULL) {
1597                 return (ENOMEM);
1598         } else {
1599                 *p = bufp;
1600                 return (0);
1601         }
1602 }
1603 
1604 static void
1605 fss_free(void *bufp)
1606 {
1607         if (bufp)
1608                 kmem_free(bufp, sizeof (fssproc_t));
1609 }
1610 
1611 /*
1612  * Thread functions
1613  */
1614 static int
1615 fss_enterclass(kthread_t *t, id_t cid, void *parmsp, cred_t *reqpcredp,
1616     void *bufp)
1617 {
1618         fssparms_t      *fssparmsp = (fssparms_t *)parmsp;
1619         fssproc_t       *fssproc;
1620         pri_t           reqfssuprilim;
1621         pri_t           reqfssupri;
1622         static uint32_t fssexists = 0;
1623         fsspset_t       *fsspset;
1624         fssproj_t       *fssproj;
1625         fsszone_t       *fsszone;
1626         kproject_t      *kpj;
1627         zone_t          *zone;
1628         int             fsszone_allocated = 0;
1629 
1630         fssproc = (fssproc_t *)bufp;
1631         ASSERT(fssproc != NULL);
1632 
1633         ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
1634 
1635         /*
1636          * Only root can move threads to FSS class.
1637          */
1638         if (reqpcredp != NULL && secpolicy_setpriority(reqpcredp) != 0)
1639                 return (EPERM);
1640         /*
1641          * Initialize the fssproc structure.
1642          */
1643         fssproc->fss_umdpri = fss_maxumdpri / 2;
1644 
1645         if (fssparmsp == NULL) {
1646                 /*
1647                  * Use default values.
1648                  */
1649                 fssproc->fss_nice = NZERO;
1650                 fssproc->fss_uprilim = fssproc->fss_upri = 0;
1651         } else {
1652                 /*
1653                  * Use supplied values.
1654                  */
1655                 if (fssparmsp->fss_uprilim == FSS_NOCHANGE) {
1656                         reqfssuprilim = 0;
1657                 } else {
1658                         if (fssparmsp->fss_uprilim > 0 &&
1659                             secpolicy_setpriority(reqpcredp) != 0)
1660                                 return (EPERM);
1661                         reqfssuprilim = fssparmsp->fss_uprilim;
1662                 }
1663                 if (fssparmsp->fss_upri == FSS_NOCHANGE) {
1664                         reqfssupri = reqfssuprilim;
1665                 } else {
1666                         if (fssparmsp->fss_upri > 0 &&
1667                             secpolicy_setpriority(reqpcredp) != 0)
1668                                 return (EPERM);
1669                         /*
1670                          * Set the user priority to the requested value or
1671                          * the upri limit, whichever is lower.
1672                          */
1673                         reqfssupri = fssparmsp->fss_upri;
1674                         if (reqfssupri > reqfssuprilim)
1675                                 reqfssupri = reqfssuprilim;
1676                 }
1677                 fssproc->fss_uprilim = reqfssuprilim;
1678                 fssproc->fss_upri = reqfssupri;
1679                 fssproc->fss_nice = NZERO - (NZERO * reqfssupri) / fss_maxupri;
1680                 if (fssproc->fss_nice > FSS_NICE_MAX)
1681                         fssproc->fss_nice = FSS_NICE_MAX;
1682         }
1683 
1684         fssproc->fss_timeleft = fss_quantum;
1685         fssproc->fss_tp = t;
1686         cpucaps_sc_init(&fssproc->fss_caps);
1687 
1688         /*
1689          * Put a lock on our fsspset structure.
1690          */
1691         mutex_enter(&fsspsets_lock);
1692         fsspset = fss_find_fsspset(t->t_cpupart);
1693         mutex_enter(&fsspset->fssps_lock);
1694         mutex_exit(&fsspsets_lock);
1695 
1696         zone = ttoproc(t)->p_zone;
1697         if ((fsszone = fss_find_fsszone(fsspset, zone)) == NULL) {
1698                 if ((fsszone = kmem_zalloc(sizeof (fsszone_t), KM_NOSLEEP))
1699                     == NULL) {
1700                         mutex_exit(&fsspset->fssps_lock);
1701                         return (ENOMEM);
1702                 } else {
1703                         fsszone_allocated = 1;
1704                         fss_insert_fsszone(fsspset, zone, fsszone);
1705                 }
1706         }
1707         kpj = ttoproj(t);
1708         if ((fssproj = fss_find_fssproj(fsspset, kpj)) == NULL) {
1709                 if ((fssproj = kmem_zalloc(sizeof (fssproj_t), KM_NOSLEEP))
1710                     == NULL) {
1711                         if (fsszone_allocated) {
1712                                 fss_remove_fsszone(fsspset, fsszone);
1713                                 kmem_free(fsszone, sizeof (fsszone_t));
1714                         }
1715                         mutex_exit(&fsspset->fssps_lock);
1716                         return (ENOMEM);
1717                 } else {
1718                         fss_insert_fssproj(fsspset, kpj, fsszone, fssproj);
1719                 }
1720         }
1721         fssproj->fssp_threads++;
1722         fssproc->fss_proj = fssproj;
1723 
1724         /*
1725          * Reset priority. Process goes to a "user mode" priority here
1726          * regardless of whether or not it has slept since entering the kernel.
1727          */
1728         thread_lock(t);
1729         t->t_clfuncs = &(sclass[cid].cl_funcs->thread);
1730         t->t_cid = cid;
1731         t->t_cldata = (void *)fssproc;
1732         t->t_schedflag |= TS_RUNQMATCH;
1733         fss_change_priority(t, fssproc);
1734         if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
1735             t->t_state == TS_WAIT)
1736                 fss_active(t);
1737         thread_unlock(t);
1738 
1739         mutex_exit(&fsspset->fssps_lock);
1740 
1741         /*
1742          * Link new structure into fssproc list.
1743          */
1744         FSS_LIST_INSERT(fssproc);
1745 
1746         /*
1747          * If this is the first fair-sharing thread to occur since boot,
1748          * we set up the initial call to fss_update() here. Use an atomic
1749          * compare-and-swap since that's easier and faster than a mutex
1750          * (but check with an ordinary load first since most of the time
1751          * this will already be done).
1752          */
1753         if (fssexists == 0 && atomic_cas_32(&fssexists, 0, 1) == 0)
1754                 (void) timeout(fss_update, NULL, hz);
1755 
1756         return (0);
1757 }
1758 
1759 /*
1760  * Remove fssproc_t from the list.
1761  */
1762 static void
1763 fss_exitclass(void *procp)
1764 {
1765         fssproc_t *fssproc = (fssproc_t *)procp;
1766         fssproj_t *fssproj;
1767         fsspset_t *fsspset;
1768         fsszone_t *fsszone;
1769         kthread_t *t = fssproc->fss_tp;
1770 
1771         /*
1772          * We should be either getting this thread off the deathrow or
1773          * this thread has already moved to another scheduling class and
1774          * we're being called with its old cldata buffer pointer.  In both
1775          * cases, the content of this buffer can not be changed while we're
1776          * here.
1777          */
1778         mutex_enter(&fsspsets_lock);
1779         thread_lock(t);
1780         if (t->t_cid != fss_cid) {
1781                 /*
1782                  * We're being called as a result of the priocntl() system
1783                  * call -- someone is trying to move our thread to another
1784                  * scheduling class. We can't call fss_inactive() here
1785                  * because our thread's t_cldata pointer already points
1786                  * to another scheduling class specific data.
1787                  */
1788                 ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
1789 
1790                 fssproj = FSSPROC2FSSPROJ(fssproc);
1791                 fsspset = FSSPROJ2FSSPSET(fssproj);
1792                 fsszone = fssproj->fssp_fsszone;
1793 
1794                 if (fssproc->fss_runnable) {
1795                         disp_lock_enter_high(&fsspset->fssps_displock);
1796                         if (--fssproj->fssp_runnable == 0) {
1797                                 fsszone->fssz_shares -= fssproj->fssp_shares;
1798                                 if (--fsszone->fssz_runnable == 0)
1799                                         fsspset->fssps_shares -=
1800                                             fsszone->fssz_rshares;
1801                         }
1802                         disp_lock_exit_high(&fsspset->fssps_displock);
1803                 }
1804                 thread_unlock(t);
1805 
1806                 mutex_enter(&fsspset->fssps_lock);
1807                 if (--fssproj->fssp_threads == 0) {
1808                         fss_remove_fssproj(fsspset, fssproj);
1809                         if (fsszone->fssz_nproj == 0)
1810                                 kmem_free(fsszone, sizeof (fsszone_t));
1811                         kmem_free(fssproj, sizeof (fssproj_t));
1812                 }
1813                 mutex_exit(&fsspset->fssps_lock);
1814 
1815         } else {
1816                 ASSERT(t->t_state == TS_FREE);
1817                 /*
1818                  * We're being called from thread_free() when our thread
1819                  * is removed from the deathrow. There is nothing we need
1820                  * do here since everything should've been done earlier
1821                  * in fss_exit().
1822                  */
1823                 thread_unlock(t);
1824         }
1825         mutex_exit(&fsspsets_lock);
1826 
1827         FSS_LIST_DELETE(fssproc);
1828         fss_free(fssproc);
1829 }
1830 
1831 /*ARGSUSED*/
1832 static int
1833 fss_canexit(kthread_t *t, cred_t *credp)
1834 {
1835         /*
1836          * A thread is allowed to exit FSS only if we have sufficient
1837          * privileges.
1838          */
1839         if (credp != NULL && secpolicy_setpriority(credp) != 0)
1840                 return (EPERM);
1841         else
1842                 return (0);
1843 }
1844 
1845 /*
1846  * Initialize fair-share class specific proc structure for a child.
1847  */
1848 static int
1849 fss_fork(kthread_t *pt, kthread_t *ct, void *bufp)
1850 {
1851         fssproc_t *pfssproc;    /* ptr to parent's fssproc structure    */
1852         fssproc_t *cfssproc;    /* ptr to child's fssproc structure     */
1853         fssproj_t *fssproj;
1854         fsspset_t *fsspset;
1855 
1856         ASSERT(MUTEX_HELD(&ttoproc(pt)->p_lock));
1857         ASSERT(ct->t_state == TS_STOPPED);
1858 
1859         cfssproc = (fssproc_t *)bufp;
1860         ASSERT(cfssproc != NULL);
1861         bzero(cfssproc, sizeof (fssproc_t));
1862 
1863         thread_lock(pt);
1864         pfssproc = FSSPROC(pt);
1865         fssproj = FSSPROC2FSSPROJ(pfssproc);
1866         fsspset = FSSPROJ2FSSPSET(fssproj);
1867         thread_unlock(pt);
1868 
1869         mutex_enter(&fsspset->fssps_lock);
1870         /*
1871          * Initialize child's fssproc structure.
1872          */
1873         thread_lock(pt);
1874         ASSERT(FSSPROJ(pt) == fssproj);
1875         cfssproc->fss_proj = fssproj;
1876         cfssproc->fss_timeleft = fss_quantum;
1877         cfssproc->fss_umdpri = pfssproc->fss_umdpri;
1878         cfssproc->fss_fsspri = 0;
1879         cfssproc->fss_uprilim = pfssproc->fss_uprilim;
1880         cfssproc->fss_upri = pfssproc->fss_upri;
1881         cfssproc->fss_tp = ct;
1882         cfssproc->fss_nice = pfssproc->fss_nice;
1883         cpucaps_sc_init(&cfssproc->fss_caps);
1884 
1885         cfssproc->fss_flags =
1886             pfssproc->fss_flags & ~(FSSKPRI | FSSBACKQ | FSSRESTORE);
1887         ct->t_cldata = (void *)cfssproc;
1888         ct->t_schedflag |= TS_RUNQMATCH;
1889         thread_unlock(pt);
1890 
1891         fssproj->fssp_threads++;
1892         mutex_exit(&fsspset->fssps_lock);
1893 
1894         /*
1895          * Link new structure into fssproc hash table.
1896          */
1897         FSS_LIST_INSERT(cfssproc);
1898         return (0);
1899 }
1900 
1901 /*
1902  * Child is placed at back of dispatcher queue and parent gives up processor
1903  * so that the child runs first after the fork. This allows the child
1904  * immediately execing to break the multiple use of copy on write pages with no
1905  * disk home. The parent will get to steal them back rather than uselessly
1906  * copying them.
1907  */
1908 static void
1909 fss_forkret(kthread_t *t, kthread_t *ct)
1910 {
1911         proc_t *pp = ttoproc(t);
1912         proc_t *cp = ttoproc(ct);
1913         fssproc_t *fssproc;
1914 
1915         ASSERT(t == curthread);
1916         ASSERT(MUTEX_HELD(&pidlock));
1917 
1918         /*
1919          * Grab the child's p_lock before dropping pidlock to ensure the
1920          * process does not disappear before we set it running.
1921          */
1922         mutex_enter(&cp->p_lock);
1923         continuelwps(cp);
1924         mutex_exit(&cp->p_lock);
1925 
1926         mutex_enter(&pp->p_lock);
1927         mutex_exit(&pidlock);
1928         continuelwps(pp);
1929 
1930         thread_lock(t);
1931 
1932         fssproc = FSSPROC(t);
1933         fss_newpri(fssproc, B_FALSE);
1934         fssproc->fss_timeleft = fss_quantum;
1935         t->t_pri = fssproc->fss_umdpri;
1936         ASSERT(t->t_pri >= 0 && t->t_pri <= fss_maxglobpri);
1937         fssproc->fss_flags &= ~FSSKPRI;
1938         THREAD_TRANSITION(t);
1939 
1940         /*
1941          * We don't want to call fss_setrun(t) here because it may call
1942          * fss_active, which we don't need.
1943          */
1944         fssproc->fss_flags &= ~FSSBACKQ;
1945 
1946         if (t->t_disp_time != ddi_get_lbolt())
1947                 setbackdq(t);
1948         else
1949                 setfrontdq(t);
1950 
1951         thread_unlock(t);
1952         /*
1953          * Safe to drop p_lock now since it is safe to change
1954          * the scheduling class after this point.
1955          */
1956         mutex_exit(&pp->p_lock);
1957 
1958         swtch();
1959 }
1960 
1961 /*
1962  * Get the fair-sharing parameters of the thread pointed to by fssprocp into
1963  * the buffer pointed by fssparmsp.
1964  */
1965 static void
1966 fss_parmsget(kthread_t *t, void *parmsp)
1967 {
1968         fssproc_t *fssproc = FSSPROC(t);
1969         fssparms_t *fssparmsp = (fssparms_t *)parmsp;
1970 
1971         fssparmsp->fss_uprilim = fssproc->fss_uprilim;
1972         fssparmsp->fss_upri = fssproc->fss_upri;
1973 }
1974 
1975 /*ARGSUSED*/
1976 static int
1977 fss_parmsset(kthread_t *t, void *parmsp, id_t reqpcid, cred_t *reqpcredp)
1978 {
1979         char            nice;
1980         pri_t           reqfssuprilim;
1981         pri_t           reqfssupri;
1982         fssproc_t       *fssproc = FSSPROC(t);
1983         fssparms_t      *fssparmsp = (fssparms_t *)parmsp;
1984 
1985         ASSERT(MUTEX_HELD(&(ttoproc(t))->p_lock));
1986 
1987         if (fssparmsp->fss_uprilim == FSS_NOCHANGE)
1988                 reqfssuprilim = fssproc->fss_uprilim;
1989         else
1990                 reqfssuprilim = fssparmsp->fss_uprilim;
1991 
1992         if (fssparmsp->fss_upri == FSS_NOCHANGE)
1993                 reqfssupri = fssproc->fss_upri;
1994         else
1995                 reqfssupri = fssparmsp->fss_upri;
1996 
1997         /*
1998          * Make sure the user priority doesn't exceed the upri limit.
1999          */
2000         if (reqfssupri > reqfssuprilim)
2001                 reqfssupri = reqfssuprilim;
2002 
2003         /*
2004          * Basic permissions enforced by generic kernel code for all classes
2005          * require that a thread attempting to change the scheduling parameters
2006          * of a target thread be privileged or have a real or effective UID
2007          * matching that of the target thread. We are not called unless these
2008          * basic permission checks have already passed. The fair-sharing class
2009          * requires in addition that the calling thread be privileged if it
2010          * is attempting to raise the upri limit above its current value.
2011          * This may have been checked previously but if our caller passed us
2012          * a non-NULL credential pointer we assume it hasn't and we check it
2013          * here.
2014          */
2015         if ((reqpcredp != NULL) &&
2016             (reqfssuprilim > fssproc->fss_uprilim) &&
2017             secpolicy_raisepriority(reqpcredp) != 0)
2018                 return (EPERM);
2019 
2020         /*
2021          * Set fss_nice to the nice value corresponding to the user priority we
2022          * are setting.  Note that setting the nice field of the parameter
2023          * struct won't affect upri or nice.
2024          */
2025         nice = NZERO - (reqfssupri * NZERO) / fss_maxupri;
2026         if (nice > FSS_NICE_MAX)
2027                 nice = FSS_NICE_MAX;
2028 
2029         thread_lock(t);
2030 
2031         fssproc->fss_uprilim = reqfssuprilim;
2032         fssproc->fss_upri = reqfssupri;
2033         fssproc->fss_nice = nice;
2034         fss_newpri(fssproc, B_FALSE);
2035 
2036         if ((fssproc->fss_flags & FSSKPRI) != 0) {
2037                 thread_unlock(t);
2038                 return (0);
2039         }
2040 
2041         fss_change_priority(t, fssproc);
2042         thread_unlock(t);
2043         return (0);
2044 
2045 }
2046 
2047 /*
2048  * The thread is being stopped.
2049  */
2050 /*ARGSUSED*/
2051 static void
2052 fss_stop(kthread_t *t, int why, int what)
2053 {
2054         ASSERT(THREAD_LOCK_HELD(t));
2055         ASSERT(t == curthread);
2056 
2057         fss_inactive(t);
2058 }
2059 
2060 /*
2061  * The current thread is exiting, do necessary adjustments to its project
2062  */
2063 static void
2064 fss_exit(kthread_t *t)
2065 {
2066         fsspset_t *fsspset;
2067         fssproj_t *fssproj;
2068         fssproc_t *fssproc;
2069         fsszone_t *fsszone;
2070         int free = 0;
2071 
2072         /*
2073          * Thread t here is either a current thread (in which case we hold
2074          * its process' p_lock), or a thread being destroyed by forklwp_fail(),
2075          * in which case we hold pidlock and thread is no longer on the
2076          * thread list.
2077          */
2078         ASSERT(MUTEX_HELD(&(ttoproc(t))->p_lock) || MUTEX_HELD(&pidlock));
2079 
2080         fssproc = FSSPROC(t);
2081         fssproj = FSSPROC2FSSPROJ(fssproc);
2082         fsspset = FSSPROJ2FSSPSET(fssproj);
2083         fsszone = fssproj->fssp_fsszone;
2084 
2085         mutex_enter(&fsspsets_lock);
2086         mutex_enter(&fsspset->fssps_lock);
2087 
2088         thread_lock(t);
2089         disp_lock_enter_high(&fsspset->fssps_displock);
2090         if (t->t_state == TS_ONPROC || t->t_state == TS_RUN) {
2091                 if (--fssproj->fssp_runnable == 0) {
2092                         fsszone->fssz_shares -= fssproj->fssp_shares;
2093                         if (--fsszone->fssz_runnable == 0)
2094                                 fsspset->fssps_shares -= fsszone->fssz_rshares;
2095                 }
2096                 ASSERT(fssproc->fss_runnable == 1);
2097                 fssproc->fss_runnable = 0;
2098         }
2099         if (--fssproj->fssp_threads == 0) {
2100                 fss_remove_fssproj(fsspset, fssproj);
2101                 free = 1;
2102         }
2103         disp_lock_exit_high(&fsspset->fssps_displock);
2104         fssproc->fss_proj = NULL;    /* mark this thread as already exited */
2105         thread_unlock(t);
2106 
2107         if (free) {
2108                 if (fsszone->fssz_nproj == 0)
2109                         kmem_free(fsszone, sizeof (fsszone_t));
2110                 kmem_free(fssproj, sizeof (fssproj_t));
2111         }
2112         mutex_exit(&fsspset->fssps_lock);
2113         mutex_exit(&fsspsets_lock);
2114 
2115         /*
2116          * A thread could be exiting in between clock ticks, so we need to
2117          * calculate how much CPU time it used since it was charged last time.
2118          *
2119          * CPU caps are not enforced on exiting processes - it is usually
2120          * desirable to exit as soon as possible to free resources.
2121          */
2122         if (CPUCAPS_ON()) {
2123                 thread_lock(t);
2124                 fssproc = FSSPROC(t);
2125                 (void) cpucaps_charge(t, &fssproc->fss_caps,
2126                     CPUCAPS_CHARGE_ONLY);
2127                 thread_unlock(t);
2128         }
2129 }
2130 
2131 static void
2132 fss_nullsys()
2133 {
2134 }
2135 
2136 /*





































































































2137  * If thread is currently at a kernel mode priority (has slept) and is
2138  * returning to the userland we assign it the appropriate user mode priority
2139  * and time quantum here.  If we're lowering the thread's priority below that
2140  * of other runnable threads then we will set runrun via cpu_surrender() to
2141  * cause preemption.
2142  */
2143 static void
2144 fss_trapret(kthread_t *t)
2145 {
2146         fssproc_t *fssproc = FSSPROC(t);
2147         cpu_t *cp = CPU;
2148 
2149         ASSERT(THREAD_LOCK_HELD(t));
2150         ASSERT(t == curthread);
2151         ASSERT(cp->cpu_dispthread == t);
2152         ASSERT(t->t_state == TS_ONPROC);
2153 
2154         t->t_kpri_req = 0;
2155         if (fssproc->fss_flags & FSSKPRI) {
2156                 /*
2157                  * If thread has blocked in the kernel
2158                  */
2159                 THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2160                 cp->cpu_dispatch_pri = DISP_PRIO(t);
2161                 ASSERT(t->t_pri >= 0 && t->t_pri <= fss_maxglobpri);
2162                 fssproc->fss_flags &= ~FSSKPRI;
2163 
2164                 if (DISP_MUST_SURRENDER(t))
2165                         cpu_surrender(t);
2166         }










2167 }
2168 
2169 /*
2170  * Arrange for thread to be placed in appropriate location on dispatcher queue.
2171  * This is called with the current thread in TS_ONPROC and locked.
2172  */
2173 static void
2174 fss_preempt(kthread_t *t)
2175 {
2176         fssproc_t *fssproc = FSSPROC(t);
2177         klwp_t *lwp;
2178         uint_t flags;
2179 
2180         ASSERT(t == curthread);
2181         ASSERT(THREAD_LOCK_HELD(curthread));
2182         ASSERT(t->t_state == TS_ONPROC);
2183 
2184         /*
2185          * If preempted in the kernel, make sure the thread has a kernel
2186          * priority if needed.
2187          */
2188         lwp = curthread->t_lwp;
2189         if (!(fssproc->fss_flags & FSSKPRI) && lwp != NULL && t->t_kpri_req) {
2190                 fssproc->fss_flags |= FSSKPRI;
2191                 THREAD_CHANGE_PRI(t, minclsyspri);
2192                 ASSERT(t->t_pri >= 0 && t->t_pri <= fss_maxglobpri);
2193                 t->t_trapret = 1;    /* so that fss_trapret will run */
2194                 aston(t);
2195         }
2196 
2197         /*
2198          * This thread may be placed on wait queue by CPU Caps. In this case we
2199          * do not need to do anything until it is removed from the wait queue.
2200          * Do not enforce CPU caps on threads running at a kernel priority
2201          */
2202         if (CPUCAPS_ON()) {
2203                 (void) cpucaps_charge(t, &fssproc->fss_caps,
2204                     CPUCAPS_CHARGE_ENFORCE);
2205 
2206                 if (!(fssproc->fss_flags & FSSKPRI) && CPUCAPS_ENFORCE(t))
2207                         return;
2208         }
2209 
2210         /*








2211          * Check to see if we're doing "preemption control" here.  If
2212          * we are, and if the user has requested that this thread not
2213          * be preempted, and if preemptions haven't been put off for
2214          * too long, let the preemption happen here but try to make
2215          * sure the thread is rescheduled as soon as possible.  We do
2216          * this by putting it on the front of the highest priority run
2217          * queue in the FSS class.  If the preemption has been put off
2218          * for too long, clear the "nopreempt" bit and let the thread
2219          * be preempted.
2220          */
2221         if (t->t_schedctl && schedctl_get_nopreempt(t)) {
2222                 if (fssproc->fss_timeleft > -SC_MAX_TICKS) {
2223                         DTRACE_SCHED1(schedctl__nopreempt, kthread_t *, t);
2224                         if (!(fssproc->fss_flags & FSSKPRI)) {
2225                                 /*
2226                                  * If not already remembered, remember current
2227                                  * priority for restoration in fss_yield().
2228                                  */
2229                                 if (!(fssproc->fss_flags & FSSRESTORE)) {
2230                                         fssproc->fss_scpri = t->t_pri;
2231                                         fssproc->fss_flags |= FSSRESTORE;
2232                                 }
2233                                 THREAD_CHANGE_PRI(t, fss_maxumdpri);

2234                         }
2235                         schedctl_set_yield(t, 1);
2236                         setfrontdq(t);
2237                         return;
2238                 } else {
2239                         if (fssproc->fss_flags & FSSRESTORE) {
2240                                 THREAD_CHANGE_PRI(t, fssproc->fss_scpri);
2241                                 fssproc->fss_flags &= ~FSSRESTORE;
2242                         }
2243                         schedctl_set_nopreempt(t, 0);
2244                         DTRACE_SCHED1(schedctl__preempt, kthread_t *, t);
2245                         /*
2246                          * Fall through and be preempted below.
2247                          */
2248                 }
2249         }
2250 
2251         flags = fssproc->fss_flags & (FSSBACKQ | FSSKPRI);
2252 
2253         if (flags == FSSBACKQ) {
2254                 fssproc->fss_timeleft = fss_quantum;
2255                 fssproc->fss_flags &= ~FSSBACKQ;
2256                 setbackdq(t);
2257         } else if (flags == (FSSBACKQ | FSSKPRI)) {
2258                 fssproc->fss_flags &= ~FSSBACKQ;
2259                 setbackdq(t);
2260         } else {
2261                 setfrontdq(t);
2262         }
2263 }
2264 
2265 /*
2266  * Called when a thread is waking up and is to be placed on the run queue.
2267  */
2268 static void
2269 fss_setrun(kthread_t *t)
2270 {
2271         fssproc_t *fssproc = FSSPROC(t);
2272 
2273         ASSERT(THREAD_LOCK_HELD(t));    /* t should be in transition */
2274 
2275         if (t->t_state == TS_SLEEP || t->t_state == TS_STOPPED)
2276                 fss_active(t);
2277 
2278         fssproc->fss_timeleft = fss_quantum;
2279 
2280         fssproc->fss_flags &= ~FSSBACKQ;
2281         /*
2282          * If previously were running at the kernel priority then keep that
2283          * priority and the fss_timeleft doesn't matter.
2284          */
2285         if ((fssproc->fss_flags & FSSKPRI) == 0)
2286                 THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2287 
2288         if (t->t_disp_time != ddi_get_lbolt())
2289                 setbackdq(t);
2290         else
2291                 setfrontdq(t);
2292 }
2293 
2294 /*
2295  * Prepare thread for sleep. We reset the thread priority so it will run at the
2296  * kernel priority level when it wakes up.
2297  */
2298 static void
2299 fss_sleep(kthread_t *t)
2300 {
2301         fssproc_t *fssproc = FSSPROC(t);
2302 
2303         ASSERT(t == curthread);
2304         ASSERT(THREAD_LOCK_HELD(t));
2305 
2306         ASSERT(t->t_state == TS_ONPROC);
2307 
2308         /*
2309          * Account for time spent on CPU before going to sleep.
2310          */
2311         (void) CPUCAPS_CHARGE(t, &fssproc->fss_caps, CPUCAPS_CHARGE_ENFORCE);
2312 
2313         fss_inactive(t);
2314 
2315         /*
2316          * Assign a system priority to the thread and arrange for it to be
2317          * retained when the thread is next placed on the run queue (i.e.,
2318          * when it wakes up) instead of being given a new pri.  Also arrange
2319          * for trapret processing as the thread leaves the system call so it
2320          * will drop back to normal priority range.
2321          */
2322         if (t->t_kpri_req) {
2323                 THREAD_CHANGE_PRI(t, minclsyspri);
2324                 fssproc->fss_flags |= FSSKPRI;
2325                 t->t_trapret = 1;    /* so that fss_trapret will run */
2326                 aston(t);
2327         } else if (fssproc->fss_flags & FSSKPRI) {
2328                 /*
2329                  * The thread has done a THREAD_KPRI_REQUEST(), slept, then
2330                  * done THREAD_KPRI_RELEASE() (so no t_kpri_req is 0 again),
2331                  * then slept again all without finishing the current system
2332                  * call so trapret won't have cleared FSSKPRI
2333                  */
2334                 fssproc->fss_flags &= ~FSSKPRI;
2335                 THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2336                 if (DISP_MUST_SURRENDER(curthread))
2337                         cpu_surrender(t);
2338         }

2339 }
2340 
2341 /*
2342  * A tick interrupt has ocurrend on a running thread. Check to see if our
2343  * time slice has expired.

2344  */
2345 static void
2346 fss_tick(kthread_t *t)
2347 {
2348         fssproc_t *fssproc;
2349         fssproj_t *fssproj;

2350         boolean_t call_cpu_surrender = B_FALSE;
2351         boolean_t cpucaps_enforce = B_FALSE;
2352 
2353         ASSERT(MUTEX_HELD(&(ttoproc(t))->p_lock));
2354 
2355         /*
2356          * It's safe to access fsspset and fssproj structures because we're
2357          * holding our p_lock here.
2358          */
2359         thread_lock(t);
2360         fssproc = FSSPROC(t);
2361         fssproj = FSSPROC2FSSPROJ(fssproc);
2362         if (fssproj != NULL) {
2363                 fsspset_t *fsspset = FSSPROJ2FSSPSET(fssproj);
2364                 disp_lock_enter_high(&fsspset->fssps_displock);
2365                 fssproj->fssp_ticks += fss_nice_tick[fssproc->fss_nice];
2366                 fssproj->fssp_tick_cnt++;
2367                 fssproc->fss_ticks++;
2368                 disp_lock_exit_high(&fsspset->fssps_displock);
2369         }
2370 
2371         /*
2372          * Keep track of thread's project CPU usage.  Note that projects
2373          * get charged even when threads are running in the kernel.
2374          * Do not surrender CPU if running in the SYS class.
2375          */
2376         if (CPUCAPS_ON()) {
2377                 cpucaps_enforce = cpucaps_charge(t,
2378                     &fssproc->fss_caps, CPUCAPS_CHARGE_ENFORCE) &&
2379                     !(fssproc->fss_flags & FSSKPRI);
2380         }
2381 
2382         /*
2383          * A thread's execution time for threads running in the SYS class
2384          * is not tracked.
2385          */
2386         if ((fssproc->fss_flags & FSSKPRI) == 0) {
2387                 /*
2388                  * If thread is not in kernel mode, decrement its fss_timeleft
2389                  */
2390                 if (--fssproc->fss_timeleft <= 0) {
2391                         pri_t new_pri;
2392 
2393                         /*
2394                          * If we're doing preemption control and trying to
2395                          * avoid preempting this thread, just note that the
2396                          * thread should yield soon and let it keep running
2397                          * (unless it's been a while).
2398                          */
2399                         if (t->t_schedctl && schedctl_get_nopreempt(t)) {
2400                                 if (fssproc->fss_timeleft > -SC_MAX_TICKS) {
2401                                         DTRACE_SCHED1(schedctl__nopreempt,
2402                                             kthread_t *, t);
2403                                         schedctl_set_yield(t, 1);
2404                                         thread_unlock_nopreempt(t);
2405                                         return;
2406                                 }
2407                         }
2408                         fssproc->fss_flags &= ~FSSRESTORE;
2409 
2410                         fss_newpri(fssproc, B_TRUE);
2411                         new_pri = fssproc->fss_umdpri;
2412                         ASSERT(new_pri >= 0 && new_pri <= fss_maxglobpri);
2413 
2414                         /*
2415                          * When the priority of a thread is changed, it may
2416                          * be necessary to adjust its position on a sleep queue
2417                          * or dispatch queue. The function thread_change_pri
2418                          * accomplishes this.
2419                          */
2420                         if (thread_change_pri(t, new_pri, 0)) {




2421                                 fssproc->fss_timeleft = fss_quantum;
2422                         } else {
2423                                 call_cpu_surrender = B_TRUE;
2424                         }
2425                 } else if (t->t_state == TS_ONPROC &&
2426                     t->t_pri < t->t_disp_queue->disp_maxrunpri) {
2427                         /*
2428                          * If there is a higher-priority thread which is
2429                          * waiting for a processor, then thread surrenders
2430                          * the processor.
2431                          */
2432                         call_cpu_surrender = B_TRUE;
2433                 }
2434         }
2435 
2436         if (cpucaps_enforce && 2 * fssproc->fss_timeleft > fss_quantum) {
2437                 /*
2438                  * The thread used more than half of its quantum, so assume that
2439                  * it used the whole quantum.
2440                  *
2441                  * Update thread's priority just before putting it on the wait
2442                  * queue so that it gets charged for the CPU time from its
2443                  * quantum even before that quantum expires.
2444                  */
2445                 fss_newpri(fssproc, B_FALSE);
2446                 if (t->t_pri != fssproc->fss_umdpri)
2447                         fss_change_priority(t, fssproc);
2448 
2449                 /*
2450                  * We need to call cpu_surrender for this thread due to cpucaps
2451                  * enforcement, but fss_change_priority may have already done
2452                  * so. In this case FSSBACKQ is set and there is no need to call
2453                  * cpu-surrender again.
2454                  */
2455                 if (!(fssproc->fss_flags & FSSBACKQ))
2456                         call_cpu_surrender = B_TRUE;
2457         }
2458 
2459         if (call_cpu_surrender) {
2460                 fssproc->fss_flags |= FSSBACKQ;
2461                 cpu_surrender(t);
2462         }
2463 
2464         thread_unlock_nopreempt(t);     /* clock thread can't be preempted */
2465 }
2466 
2467 /*
2468  * Processes waking up go to the back of their queue.  We don't need to assign
2469  * a time quantum here because thread is still at a kernel mode priority and
2470  * the time slicing is not done for threads running in the kernel after
2471  * sleeping.  The proper time quantum will be assigned by fss_trapret before the
2472  * thread returns to user mode.
2473  */
2474 static void
2475 fss_wakeup(kthread_t *t)
2476 {
2477         fssproc_t *fssproc;
2478 
2479         ASSERT(THREAD_LOCK_HELD(t));
2480         ASSERT(t->t_state == TS_SLEEP);
2481 
2482         fss_active(t);
2483 

2484         fssproc = FSSPROC(t);
2485         fssproc->fss_flags &= ~FSSBACKQ;
2486 
2487         if (fssproc->fss_flags & FSSKPRI) {
2488                 /*
2489                  * If we already have a kernel priority assigned, then we
2490                  * just use it.
2491                  */
2492                 setbackdq(t);
2493         } else if (t->t_kpri_req) {
2494                 /*
2495                  * Give thread a priority boost if we were asked.
2496                  */
2497                 fssproc->fss_flags |= FSSKPRI;
2498                 THREAD_CHANGE_PRI(t, minclsyspri);
2499                 setbackdq(t);
2500                 t->t_trapret = 1;    /* so that fss_trapret will run */
2501                 aston(t);
2502         } else {
2503                 /*
2504                  * Otherwise, we recalculate the priority.
2505                  */
2506                 if (t->t_disp_time == ddi_get_lbolt()) {
2507                         setfrontdq(t);
2508                 } else {
2509                         fssproc->fss_timeleft = fss_quantum;
2510                         THREAD_CHANGE_PRI(t, fssproc->fss_umdpri);
2511                         setbackdq(t);
2512                 }
2513         }
2514 }
2515 
2516 /*
2517  * fss_donice() is called when a nice(1) command is issued on the thread to
2518  * alter the priority. The nice(1) command exists in Solaris for compatibility.
2519  * Thread priority adjustments should be done via priocntl(1).
2520  */
2521 static int
2522 fss_donice(kthread_t *t, cred_t *cr, int incr, int *retvalp)
2523 {
2524         int newnice;
2525         fssproc_t *fssproc = FSSPROC(t);
2526         fssparms_t fssparms;
2527 
2528         /*
2529          * If there is no change to priority, just return current setting.
2530          */
2531         if (incr == 0) {
2532                 if (retvalp)
2533                         *retvalp = fssproc->fss_nice - NZERO;
2534                 return (0);
2535         }
2536 
2537         if ((incr < 0 || incr > 2 * NZERO) && secpolicy_raisepriority(cr) != 0)
2538                 return (EPERM);
2539 
2540         /*
2541          * Specifying a nice increment greater than the upper limit of
2542          * FSS_NICE_MAX (== 2 * NZERO - 1) will result in the thread's nice
2543          * value being set to the upper limit.  We check for this before
2544          * computing the new value because otherwise we could get overflow
2545          * if a privileged user specified some ridiculous increment.
2546          */
2547         if (incr > FSS_NICE_MAX)
2548                 incr = FSS_NICE_MAX;
2549 
2550         newnice = fssproc->fss_nice + incr;
2551         if (newnice > FSS_NICE_MAX)
2552                 newnice = FSS_NICE_MAX;
2553         else if (newnice < FSS_NICE_MIN)
2554                 newnice = FSS_NICE_MIN;
2555 
2556         fssparms.fss_uprilim = fssparms.fss_upri =
2557             -((newnice - NZERO) * fss_maxupri) / NZERO;
2558 
2559         /*
2560          * Reset the uprilim and upri values of the thread.
2561          */
2562         (void) fss_parmsset(t, (void *)&fssparms, (id_t)0, (cred_t *)NULL);
2563 
2564         /*
2565          * Although fss_parmsset already reset fss_nice it may not have been
2566          * set to precisely the value calculated above because fss_parmsset
2567          * determines the nice value from the user priority and we may have
2568          * truncated during the integer conversion from nice value to user
2569          * priority and back. We reset fss_nice to the value we calculated
2570          * above.
2571          */
2572         fssproc->fss_nice = (char)newnice;
2573 
2574         if (retvalp)
2575                 *retvalp = newnice - NZERO;
2576         return (0);
2577 }
2578 
2579 /*
2580  * Increment the priority of the specified thread by incr and
2581  * return the new value in *retvalp.
2582  */
2583 static int
2584 fss_doprio(kthread_t *t, cred_t *cr, int incr, int *retvalp)
2585 {
2586         int newpri;
2587         fssproc_t *fssproc = FSSPROC(t);
2588         fssparms_t fssparms;
2589 
2590         /*
2591          * If there is no change to priority, just return current setting.
2592          */
2593         if (incr == 0) {
2594                 *retvalp = fssproc->fss_upri;
2595                 return (0);
2596         }
2597 
2598         newpri = fssproc->fss_upri + incr;
2599         if (newpri > fss_maxupri || newpri < -fss_maxupri)
2600                 return (EINVAL);
2601 
2602         *retvalp = newpri;
2603         fssparms.fss_uprilim = fssparms.fss_upri = newpri;
2604 
2605         /*
2606          * Reset the uprilim and upri values of the thread.
2607          */
2608         return (fss_parmsset(t, &fssparms, (id_t)0, cr));
2609 }
2610 
2611 /*
2612  * Return the global scheduling priority that would be assigned to a thread
2613  * entering the fair-sharing class with the fss_upri.
2614  */
2615 /*ARGSUSED*/
2616 static pri_t
2617 fss_globpri(kthread_t *t)
2618 {
2619         ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
2620 
2621         return (fss_maxumdpri / 2);
2622 }
2623 
2624 /*
2625  * Called from the yield(2) system call when a thread is yielding (surrendering)
2626  * the processor. The kernel thread is placed at the back of a dispatch queue.
2627  */
2628 static void
2629 fss_yield(kthread_t *t)
2630 {
2631         fssproc_t *fssproc = FSSPROC(t);
2632 
2633         ASSERT(t == curthread);
2634         ASSERT(THREAD_LOCK_HELD(t));
2635 
2636         /*
2637          * Collect CPU usage spent before yielding
2638          */
2639         (void) CPUCAPS_CHARGE(t, &fssproc->fss_caps, CPUCAPS_CHARGE_ENFORCE);
2640 
2641         /*
2642          * Clear the preemption control "yield" bit since the user is
2643          * doing a yield.
2644          */
2645         if (t->t_schedctl)
2646                 schedctl_set_yield(t, 0);
2647         /*
2648          * If fss_preempt() artifically increased the thread's priority
2649          * to avoid preemption, restore the original priority now.
2650          */
2651         if (fssproc->fss_flags & FSSRESTORE) {
2652                 THREAD_CHANGE_PRI(t, fssproc->fss_scpri);
2653                 fssproc->fss_flags &= ~FSSRESTORE;
2654         }
2655         if (fssproc->fss_timeleft < 0) {
2656                 /*
2657                  * Time slice was artificially extended to avoid preemption,
2658                  * so pretend we're preempting it now.
2659                  */
2660                 DTRACE_SCHED1(schedctl__yield, int, -fssproc->fss_timeleft);
2661                 fssproc->fss_timeleft = fss_quantum;
2662         }
2663         fssproc->fss_flags &= ~FSSBACKQ;
2664         setbackdq(t);
2665 }
2666 
2667 void
2668 fss_changeproj(kthread_t *t, void *kp, void *zp, fssbuf_t *projbuf,
2669     fssbuf_t *zonebuf)
2670 {
2671         kproject_t *kpj_new = kp;
2672         zone_t *zone = zp;
2673         fssproj_t *fssproj_old, *fssproj_new;
2674         fsspset_t *fsspset;
2675         kproject_t *kpj_old;
2676         fssproc_t *fssproc;
2677         fsszone_t *fsszone_old, *fsszone_new;
2678         int free = 0;
2679         int id;
2680 
2681         ASSERT(MUTEX_HELD(&cpu_lock));
2682         ASSERT(MUTEX_HELD(&pidlock));
2683         ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
2684 
2685         if (t->t_cid != fss_cid)
2686                 return;
2687 
2688         fssproc = FSSPROC(t);
2689         mutex_enter(&fsspsets_lock);
2690         fssproj_old = FSSPROC2FSSPROJ(fssproc);
2691         if (fssproj_old == NULL) {
2692                 mutex_exit(&fsspsets_lock);
2693                 return;
2694         }
2695 
2696         fsspset = FSSPROJ2FSSPSET(fssproj_old);
2697         mutex_enter(&fsspset->fssps_lock);
2698         kpj_old = FSSPROJ2KPROJ(fssproj_old);
2699         fsszone_old = fssproj_old->fssp_fsszone;
2700 
2701         ASSERT(t->t_cpupart == fsspset->fssps_cpupart);
2702 
2703         if (kpj_old == kpj_new) {
2704                 mutex_exit(&fsspset->fssps_lock);
2705                 mutex_exit(&fsspsets_lock);
2706                 return;
2707         }
2708 
2709         if ((fsszone_new = fss_find_fsszone(fsspset, zone)) == NULL) {
2710                 /*
2711                  * If the zone for the new project is not currently active on
2712                  * the cpu partition we're on, get one of the pre-allocated
2713                  * buffers and link it in our per-pset zone list.  Such buffers
2714                  * should already exist.
2715                  */
2716                 for (id = 0; id < zonebuf->fssb_size; id++) {
2717                         if ((fsszone_new = zonebuf->fssb_list[id]) != NULL) {
2718                                 fss_insert_fsszone(fsspset, zone, fsszone_new);
2719                                 zonebuf->fssb_list[id] = NULL;
2720                                 break;
2721                         }
2722                 }
2723         }
2724         ASSERT(fsszone_new != NULL);
2725         if ((fssproj_new = fss_find_fssproj(fsspset, kpj_new)) == NULL) {
2726                 /*
2727                  * If our new project is not currently running
2728                  * on the cpu partition we're on, get one of the
2729                  * pre-allocated buffers and link it in our new cpu
2730                  * partition doubly linked list. Such buffers should already
2731                  * exist.
2732                  */
2733                 for (id = 0; id < projbuf->fssb_size; id++) {
2734                         if ((fssproj_new = projbuf->fssb_list[id]) != NULL) {
2735                                 fss_insert_fssproj(fsspset, kpj_new,
2736                                     fsszone_new, fssproj_new);
2737                                 projbuf->fssb_list[id] = NULL;
2738                                 break;
2739                         }
2740                 }
2741         }
2742         ASSERT(fssproj_new != NULL);
2743 
2744         thread_lock(t);
2745         if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2746             t->t_state == TS_WAIT)
2747                 fss_inactive(t);
2748         ASSERT(fssproj_old->fssp_threads > 0);
2749         if (--fssproj_old->fssp_threads == 0) {
2750                 fss_remove_fssproj(fsspset, fssproj_old);
2751                 free = 1;
2752         }
2753         fssproc->fss_proj = fssproj_new;
2754         fssproc->fss_fsspri = 0;
2755         fssproj_new->fssp_threads++;
2756         if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2757             t->t_state == TS_WAIT)
2758                 fss_active(t);
2759         thread_unlock(t);
2760         if (free) {
2761                 if (fsszone_old->fssz_nproj == 0)
2762                         kmem_free(fsszone_old, sizeof (fsszone_t));
2763                 kmem_free(fssproj_old, sizeof (fssproj_t));
2764         }
2765 
2766         mutex_exit(&fsspset->fssps_lock);
2767         mutex_exit(&fsspsets_lock);
2768 }
2769 
2770 void
2771 fss_changepset(kthread_t *t, void *newcp, fssbuf_t *projbuf,
2772     fssbuf_t *zonebuf)
2773 {
2774         fsspset_t *fsspset_old, *fsspset_new;
2775         fssproj_t *fssproj_old, *fssproj_new;
2776         fsszone_t *fsszone_old, *fsszone_new;
2777         fssproc_t *fssproc;
2778         kproject_t *kpj;
2779         zone_t *zone;
2780         int id;
2781 
2782         ASSERT(MUTEX_HELD(&cpu_lock));
2783         ASSERT(MUTEX_HELD(&pidlock));
2784         ASSERT(MUTEX_HELD(&ttoproc(t)->p_lock));
2785 
2786         if (t->t_cid != fss_cid)
2787                 return;
2788 
2789         fssproc = FSSPROC(t);
2790         zone = ttoproc(t)->p_zone;
2791         mutex_enter(&fsspsets_lock);
2792         fssproj_old = FSSPROC2FSSPROJ(fssproc);
2793         if (fssproj_old == NULL) {
2794                 mutex_exit(&fsspsets_lock);
2795                 return;
2796         }
2797         fsszone_old = fssproj_old->fssp_fsszone;
2798         fsspset_old = FSSPROJ2FSSPSET(fssproj_old);
2799         kpj = FSSPROJ2KPROJ(fssproj_old);
2800 
2801         if (fsspset_old->fssps_cpupart == newcp) {
2802                 mutex_exit(&fsspsets_lock);
2803                 return;
2804         }
2805 
2806         ASSERT(ttoproj(t) == kpj);
2807 
2808         fsspset_new = fss_find_fsspset(newcp);
2809 
2810         mutex_enter(&fsspset_new->fssps_lock);
2811         if ((fsszone_new = fss_find_fsszone(fsspset_new, zone)) == NULL) {
2812                 for (id = 0; id < zonebuf->fssb_size; id++) {
2813                         if ((fsszone_new = zonebuf->fssb_list[id]) != NULL) {
2814                                 fss_insert_fsszone(fsspset_new, zone,
2815                                     fsszone_new);
2816                                 zonebuf->fssb_list[id] = NULL;
2817                                 break;
2818                         }
2819                 }
2820         }
2821         ASSERT(fsszone_new != NULL);
2822         if ((fssproj_new = fss_find_fssproj(fsspset_new, kpj)) == NULL) {
2823                 for (id = 0; id < projbuf->fssb_size; id++) {
2824                         if ((fssproj_new = projbuf->fssb_list[id]) != NULL) {
2825                                 fss_insert_fssproj(fsspset_new, kpj,
2826                                     fsszone_new, fssproj_new);
2827                                 projbuf->fssb_list[id] = NULL;
2828                                 break;
2829                         }
2830                 }
2831         }
2832         ASSERT(fssproj_new != NULL);
2833 
2834         fssproj_new->fssp_threads++;
2835         thread_lock(t);
2836         if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2837             t->t_state == TS_WAIT)
2838                 fss_inactive(t);
2839         fssproc->fss_proj = fssproj_new;
2840         fssproc->fss_fsspri = 0;
2841         if (t->t_state == TS_RUN || t->t_state == TS_ONPROC ||
2842             t->t_state == TS_WAIT)
2843                 fss_active(t);
2844         thread_unlock(t);
2845         mutex_exit(&fsspset_new->fssps_lock);
2846 
2847         mutex_enter(&fsspset_old->fssps_lock);
2848         if (--fssproj_old->fssp_threads == 0) {
2849                 fss_remove_fssproj(fsspset_old, fssproj_old);
2850                 if (fsszone_old->fssz_nproj == 0)
2851                         kmem_free(fsszone_old, sizeof (fsszone_t));
2852                 kmem_free(fssproj_old, sizeof (fssproj_t));
2853         }
2854         mutex_exit(&fsspset_old->fssps_lock);
2855 
2856         mutex_exit(&fsspsets_lock);
2857 }
--- EOF ---